![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 021220102836.jpg | 2018-04-03 16:55 | 909K | |
![[IMG]](/icons/image2.gif) | 033Spectrum120604ArtPg1 Hodges interview and photo.jpg | 2020-12-16 09:57 | 1.4M | |
![[IMG]](/icons/image2.gif) | 6.jpg | 2022-10-26 14:02 | 145K | |
![[IMG]](/icons/image2.gif) | 8 months ready to travel.jpg | 2018-04-03 16:56 | 558K | |
![[IMG]](/icons/image2.gif) | 99th infantry badge Sabo.jpg | 2021-01-08 18:14 | 174K | |
![[IMG]](/icons/image2.gif) | 2013-06-20 Diving Alum Bay 1 Wreck raw and jpeg 070.jpg | 2023-02-01 17:12 | 249K | |
![[IMG]](/icons/image2.gif) | 44011_06_00033-01833.jpg | 2021-03-11 15:09 | 306K | |
![[IMG]](/icons/image2.gif) | 20200306_114229.jpg | 2020-12-15 17:58 | 2.7M | |
![[IMG]](/icons/image2.gif) | 20200306_114849.jpg | 2020-12-15 17:23 | 2.6M | |
![[IMG]](/icons/image2.gif) | 221120092040.jpg | 2018-04-03 17:14 | 768K | |
![[IMG]](/icons/image2.gif) | ABII03-A02.jpg | 2022-10-26 13:50 | 156K | |
![[IMG]](/icons/image2.gif) | Acorn Bathymetry 2015.png | 2018-09-17 13:46 | 805K | |
![[IMG]](/icons/image2.gif) | Adams.png | 2018-06-28 15:59 | 1.8M | |
![[ ]](/icons/layout.gif) | Afric.pdf | 2018-11-01 14:20 | 337K | |
![[IMG]](/icons/image2.gif) | Afric.png | 2018-07-05 15:06 | 3.3M | |
![[IMG]](/icons/image2.gif) | Afric Bathymetry 2010.png | 2018-09-06 14:09 | 1.6M | |
![[IMG]](/icons/image2.gif) | Afric_Porthole_DRobinson.jpg | 2019-05-02 09:47 | 131K | |
![[IMG]](/icons/image2.gif) | Afric_Starboard_Prop_DRobinson.jpg | 2019-05-02 09:47 | 86K | |
![[IMG]](/icons/image2.gif) | Afric_Starboard_prop2_DRobinson.jpg | 2019-05-02 09:47 | 92K | |
![[IMG]](/icons/image2.gif) | Africa Bathymetry 2010.png | 2018-09-06 14:13 | 1.6M | |
![[IMG]](/icons/image2.gif) | Ailsa Craig Bathymetry 2015.png | 2018-10-04 14:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Airship Z15.pdf | 2018-11-13 11:22 | 861K | |
![[IMG]](/icons/image2.gif) | Alaunia.png | 2018-11-19 13:12 | 3.9M | |
![[IMG]](/icons/image2.gif) | Alaunia_Bathymetry.png | 2018-04-24 08:52 | 3.3M | |
![[IMG]](/icons/image2.gif) | Albion II (CCO).png | 2018-10-10 10:12 | 453K | |
![[IMG]](/icons/image2.gif) | Aldershot.png | 2018-07-19 14:58 | 3.7M | |
![[IMG]](/icons/image2.gif) | Alum Bay Pier - 2010_ Round pilings_Courtesy of Dave Johnston.jpg | 2023-01-31 08:32 | 26K | |
![[IMG]](/icons/image2.gif) | Alum Bay_2010_Iron Bar of Alum Bay pier_Courtesy of Dave Johnston.jpg | 2023-01-31 08:28 | 28K | |
![[IMG]](/icons/image2.gif) | Alum_Bay_Pier_1910_postcard_CCM.JPG | 2023-04-26 15:03 | 138K | |
![[IMG]](/icons/image2.gif) | Alum_Bay_Pier_Partly_collapsed_CCM.JPG | 2023-04-26 15:08 | 62K | |
![[IMG]](/icons/image2.gif) | Alum_Bay_Pier_negative1923-4_CCM.JPG | 2023-04-26 15:05 | 67K | |
![[IMG]](/icons/image2.gif) | Alum_Bay_Pier_postcard_CCM.JPG | 2023-04-26 15:11 | 104K | |
![[IMG]](/icons/image2.gif) | Alum_Bay_Pier_with_PaddleSteamer_CCM.JPG | 2023-04-26 15:13 | 96K | |
![[IMG]](/icons/image2.gif) | Amelie.png | 2018-07-05 15:13 | 380K | |
![[IMG]](/icons/image2.gif) | Andrew Elam draft card pg 1.jpg | 2021-01-07 09:45 | 232K | |
![[IMG]](/icons/image2.gif) | Andrew Elam draft card pg 2.jpg | 2021-01-07 09:45 | 200K | |
![[IMG]](/icons/image2.gif) | Anglia.png | 2018-07-26 15:19 | 1.4M | |
![[IMG]](/icons/image2.gif) | Anomaly plan.jpg | 2022-10-31 12:28 | 276K | |
![[IMG]](/icons/image2.gif) | Antonio.png | 2018-07-26 10:02 | 1.3M | |
![[IMG]](/icons/image2.gif) | Antwerpen.png | 2018-10-10 10:13 | 900K | |
![[IMG]](/icons/image2.gif) | Aparima.png | 2018-11-19 13:37 | 5.7M | |
![[IMG]](/icons/image2.gif) | Apley.png | 2019-03-13 11:03 | 4.6M | |
![[IMG]](/icons/image2.gif) | Aracataca Bathymetry 2015.png | 2018-09-06 14:28 | 1.9M | |
![[IMG]](/icons/image2.gif) | Asaba.png | 2018-07-05 15:17 | 1.6M | |
![[IMG]](/icons/image2.gif) | Asborg.png | 2018-11-19 13:42 | 5.4M | |
![[IMG]](/icons/image2.gif) | Atlantis.png | 2018-07-05 15:21 | 2.4M | |
![[IMG]](/icons/image2.gif) | Australbush_DRobinson.jpg | 2019-05-02 09:49 | 96K | |
![[IMG]](/icons/image2.gif) | Australbush_engine_DRobinson.jpg | 2019-05-02 09:49 | 124K | |
![[IMG]](/icons/image2.gif) | Australbush_prop_shaft_DRobinson.jpg | 2019-05-02 09:49 | 92K | |
![[IMG]](/icons/image2.gif) | B-17 Scrappy Mike.jpg | 2021-02-03 08:56 | 23K | |
![[IMG]](/icons/image2.gif) | BEal DIscharge form Ancestry_REDUCE.jpg | 2021-01-14 16:27 | 4.1M | |
![[IMG]](/icons/image2.gif) | Balarat (Ballarat).png | 2018-07-05 15:25 | 1.9M | |
![[IMG]](/icons/image2.gif) | Bamse Bathymetry 2014.png | 2018-09-03 10:49 | 476K | |
![[IMG]](/icons/image2.gif) | Baron Garioch Navitus Bay.PNG | 2018-10-10 11:37 | 1.0M | |
![[IMG]](/icons/image2.gif) | Bay Brick.jpg | 2021-01-05 13:15 | 2.0M | |
![[IMG]](/icons/image2.gif) | Bay Brick_REDUCE.jpg | 2021-01-14 16:21 | 2.0M | |
![[IMG]](/icons/image2.gif) | Bay Draft Card pg 1.jpg | 2021-01-05 13:20 | 193K | |
![[IMG]](/icons/image2.gif) | Bay Draft Card pg 2.jpg | 2021-01-05 13:21 | 162K | |
![[IMG]](/icons/image2.gif) | Bay Grave.jpg | 2021-01-05 13:18 | 301K | |
![[IMG]](/icons/image2.gif) | Bay REDUCE.jpeg | 2021-01-14 16:26 | 3.2M | |
![[IMG]](/icons/image2.gif) | Baychattan.png | 2018-07-05 15:28 | 461K | |
![[IMG]](/icons/image2.gif) | Beal_Brick_REDUCE.jpg | 2021-01-14 16:28 | 3.4M | |
![[IMG]](/icons/image2.gif) | Beal_Draft card pg 1.jpg | 2021-01-05 10:53 | 790K | |
![[IMG]](/icons/image2.gif) | Beal_Draft card pg 2.jpg | 2021-01-05 10:53 | 776K | |
![[IMG]](/icons/image2.gif) | Beal photo_Copy.jpg | 2020-12-14 17:52 | 532K | |
![[IMG]](/icons/image2.gif) | Beatrice Bathymetry 2014.png | 2018-09-03 10:41 | 500K | |
![[IMG]](/icons/image2.gif) | Beechpark Bathymetry 2016.png | 2018-09-06 15:54 | 1.0M | |
![[IMG]](/icons/image2.gif) | Belle Ile.png | 2018-07-05 15:33 | 398K | |
![[IMG]](/icons/image2.gif) | Benito.png | 2018-07-05 15:36 | 1.8M | |
![[IMG]](/icons/image2.gif) | Benito Bathymetry 2014.png | 2018-09-03 10:51 | 770K | |
![[IMG]](/icons/image2.gif) | Bilge Keel.jpg | 2024-09-05 10:10 | 605K | |
![[IMG]](/icons/image2.gif) | Bill Bathymetry 2011.png | 2018-10-08 11:23 | 2.7M | |
![[IMG]](/icons/image2.gif) | Bill Roby_inscription.png | 2021-01-08 18:08 | 99K | |
![[IMG]](/icons/image2.gif) | Bill Urban.png | 2019-09-12 15:11 | 46K | |
![[IMG]](/icons/image2.gif) | Bill Urban_inscrip.png | 2020-12-22 09:36 | 37K | |
![[IMG]](/icons/image2.gif) | Bill_Urban_Inscription_2019.jpg | 2019-06-01 17:45 | 259K | |
![[IMG]](/icons/image2.gif) | Billy D_S Dec 22 44 edited.jpg | 2020-12-15 16:52 | 387K | |
![[IMG]](/icons/image2.gif) | Billy_Davis_Draft Card pg 1.jpg | 2021-01-05 10:55 | 229K | |
![[IMG]](/icons/image2.gif) | Billy_Davis_Draft Card pg 2.jpg | 2021-01-05 10:55 | 198K | |
![[IMG]](/icons/image2.gif) | Bleamoor.png | 2018-07-26 14:07 | 3.6M | |
![[IMG]](/icons/image2.gif) | Boma Bathymetry 2015.png | 2018-10-04 14:53 | 1.2M | |
![[IMG]](/icons/image2.gif) | BonarLaw(Probably).png | 2018-07-26 15:28 | 518K | |
![[IMG]](/icons/image2.gif) | Border Knight Bathymetry 2014.png | 2018-09-03 10:57 | 1.1M | |
![[IMG]](/icons/image2.gif) | Borneo Bathymetry 2015.png | 2018-09-06 14:33 | 1.2M | |
![[IMG]](/icons/image2.gif) | Bostonian Bathymetry 2015.png | 2018-10-08 13:07 | 2.7M | |
![[IMG]](/icons/image2.gif) | Boxer.png | 2018-11-19 13:42 | 325K | |
![[IMG]](/icons/image2.gif) | Braunton Bathymetry 2015.png | 2018-09-06 14:36 | 1.4M | |
![[IMG]](/icons/image2.gif) | Breech_Inscription_2019.jpg | 2019-06-01 17:25 | 570K | |
![[IMG]](/icons/image2.gif) | Breech_REDUCE.jpg | 2021-01-14 16:30 | 5.5M | |
![[IMG]](/icons/image2.gif) | Breech_Veterans Compensation form pg 2.jpg | 2021-01-05 13:30 | 666K | |
![[IMG]](/icons/image2.gif) | Bretagne Bathymetry 2015.png | 2018-10-04 14:56 | 1.0M | |
![[IMG]](/icons/image2.gif) | Brick.jpg | 2020-12-16 11:29 | 4.1M | |
![[IMG]](/icons/image2.gif) | Brick close.jpg | 2020-12-16 10:05 | 82K | |
![[IMG]](/icons/image2.gif) | Brick edited P Z Daughdrill Mc Lain Miss.jpg | 2020-12-15 16:37 | 4.3M | |
![[IMG]](/icons/image2.gif) | Bricks_Wilson Hall.JPG | 2021-01-07 10:08 | 170K | |
![[IMG]](/icons/image2.gif) | Britannia_SSS_NavitusBay.jpg | 2018-10-10 10:18 | 895K | |
![[IMG]](/icons/image2.gif) | Broderick Bathymetry 2015.png | 2018-08-31 15:03 | 682K | |
![[IMG]](/icons/image2.gif) | Broomhill Bathymetry 2015.png | 2018-10-04 14:59 | 940K | |
![[IMG]](/icons/image2.gif) | Brothers.jpg | 2021-02-02 17:30 | 82K | |
![[IMG]](/icons/image2.gif) | Brunhilda.png | 2018-07-26 14:11 | 1.1M | |
![[IMG]](/icons/image2.gif) | Bunker brick.jpg | 2021-01-04 08:39 | 3.8M | |
![[IMG]](/icons/image2.gif) | Bunker brick_REDUCE.jpg | 2021-01-14 16:33 | 3.8M | |
![[IMG]](/icons/image2.gif) | CAL_Avery_Inscription_2019.jpg | 2019-06-01 17:32 | 356K | |
![[IMG]](/icons/image2.gif) | CHARSTON SC_G12_Inscription_2019.JPG | 2019-06-01 17:41 | 245K | |
![[IMG]](/icons/image2.gif) | CHRISTENSEN BRICK IMG_20200620_155102 REDUCE.jpg | 2021-01-14 16:42 | 2.4M | |
![[IMG]](/icons/image2.gif) | CHRISTENSEN_Inscription_2019.jpg | 2019-06-01 17:40 | 112K | |
![[IMG]](/icons/image2.gif) | CLARK LOUISEVILLE KY edited_REDUCE.jpg | 2021-01-14 16:43 | 7.7M | |
![[IMG]](/icons/image2.gif) | COLBY Grave_REDUCE.jpg | 2021-01-14 16:46 | 2.6M | |
![[IMG]](/icons/image2.gif) | COLLINS.12_Andromeda_MorrabCredit.jpg | 2018-06-19 13:17 | 491K | |
![[IMG]](/icons/image2.gif) | COLLINS.100B_L1_submarine_MorrabCredit.jpg | 2018-06-19 13:46 | 352K | |
![[IMG]](/icons/image2.gif) | COLLINS.118_Manu_MorrabCredit.jpg | 2018-06-19 13:27 | 378K | |
![[IMG]](/icons/image2.gif) | COLLINS.152B_Ponus_MorrabCredit.jpg | 2018-06-19 13:31 | 433K | |
![[IMG]](/icons/image2.gif) | Cal_Avery_Inscription_2019.jpg | 2019-05-29 16:56 | 316K | |
![[IMG]](/icons/image2.gif) | Cal avery Draft Card.jpg | 2020-12-14 16:20 | 218K | |
![[IMG]](/icons/image2.gif) | Cal avery Draft Card reverse.jpg | 2020-12-14 17:20 | 204K | |
![[IMG]](/icons/image2.gif) | Camberwell.png | 2018-11-19 13:43 | 6.2M | |
![[IMG]](/icons/image2.gif) | Capture.jpg | 2018-10-16 09:27 | 107K | |
![[IMG]](/icons/image2.gif) | Capture 3.jpg | 2018-10-16 09:22 | 135K | |
![[IMG]](/icons/image2.gif) | Capture4.jpg | 2018-10-16 09:31 | 118K | |
![[IMG]](/icons/image2.gif) | Capture 5.jpg | 2018-10-16 09:22 | 127K | |
![[IMG]](/icons/image2.gif) | Carilon Bathymetry 2014.png | 2018-09-18 13:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | Carlisle Castle Bathymetry 2015.png | 2018-08-31 15:18 | 753K | |
![[IMG]](/icons/image2.gif) | Carlton.png | 2018-07-26 15:31 | 808K | |
![[IMG]](/icons/image2.gif) | Carolus Bathymetry 2014.png | 2018-08-31 15:39 | 664K | |
![[IMG]](/icons/image2.gif) | Carter brick.jpg | 2021-01-05 13:47 | 4.6M | |
![[IMG]](/icons/image2.gif) | Carter brick_REDUCE.jpg | 2021-01-14 16:41 | 4.6M | |
![[IMG]](/icons/image2.gif) | Cathay Bathymetry 2014.png | 2018-09-18 13:08 | 1.1M | |
![[IMG]](/icons/image2.gif) | Cerne Bathymetry 2017.png | 2018-10-08 10:17 | 952K | |
![[IMG]](/icons/image2.gif) | Chateau Yqem Bathymetry 2015.png | 2018-10-04 15:02 | 1.5M | |
![[IMG]](/icons/image2.gif) | Christen Aldin NN.png | 2020-12-14 18:19 | 63K | |
![[IMG]](/icons/image2.gif) | Christen Aldin NN_inscrip.jpg | 2020-12-22 10:04 | 85K | |
![[IMG]](/icons/image2.gif) | Christen Aldin NN_inscrip.png | 2020-12-22 09:59 | 32K | |
![[IMG]](/icons/image2.gif) | Christianssund Bathymetry 2016.png | 2018-09-06 15:01 | 1.0M | |
![[IMG]](/icons/image2.gif) | Christos Markettos Bathymetry 2011.png | 2018-10-08 11:27 | 3.3M | |
![[IMG]](/icons/image2.gif) | CityOfDundee Bathymetry 2016.png | 2018-09-06 15:08 | 910K | |
![[IMG]](/icons/image2.gif) | City of Brisbane Bathymetry 2015.png | 2018-10-04 14:13 | 2.2M | |
![[IMG]](/icons/image2.gif) | City of Corinth.png | 2018-11-19 13:43 | 4.8M | |
![[IMG]](/icons/image2.gif) | City of Swansea Bathymetry 2015.png | 2018-10-04 15:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | ClanMacvey.png | 2018-10-10 10:15 | 1.6M | |
![[IMG]](/icons/image2.gif) | Clark Draft Card pg 1.jpg | 2021-01-05 13:52 | 330K | |
![[IMG]](/icons/image2.gif) | Clark Draft Card pg 2.jpg | 2021-01-05 13:52 | 377K | |
![[IMG]](/icons/image2.gif) | Clark_Grave Pleasant Union Cemetery Pennsylvania.jpg | 2021-01-05 13:54 | 96K | |
![[IMG]](/icons/image2.gif) | Claverley.png | 2018-07-05 15:41 | 526K | |
![[IMG]](/icons/image2.gif) | Cleon Bathymetry 2016.png | 2018-09-06 15:50 | 298K | |
![[IMG]](/icons/image2.gif) | Clodmoor Bathymetry 2015.png | 2018-10-08 13:47 | 1.7M | |
![[IMG]](/icons/image2.gif) | Colby_Grave.jpg | 2021-01-05 13:44 | 2.6M | |
![[IMG]](/icons/image2.gif) | Colorado.png | 2018-07-26 14:14 | 3.5M | |
![[IMG]](/icons/image2.gif) | Company B 299 Oberwinter March 45 Woodrow likely third row from back second from right.jpg | 2020-12-16 11:50 | 170K | |
![[IMG]](/icons/image2.gif) | Compensation form R Breech.jpg | 2021-01-05 13:29 | 789K | |
![[IMG]](/icons/image2.gif) | Conspicuous Service Cross.jpg | 2020-12-16 12:26 | 355K | |
![[IMG]](/icons/image2.gif) | Coopy.jpg | 2021-03-10 14:43 | 219K | |
![[IMG]](/icons/image2.gif) | Coopy 2.jpg | 2021-03-10 14:44 | 226K | |
![[IMG]](/icons/image2.gif) | Correct Bathymetry 2014.png | 2018-09-18 13:10 | 1.5M | |
![[IMG]](/icons/image2.gif) | Cub 1950.JPG | 2020-12-16 12:40 | 87K | |
![[IMG]](/icons/image2.gif) | Curt Hodges.png | 2019-09-12 15:06 | 51K | |
![[IMG]](/icons/image2.gif) | Curt Hodges_Inscription_2019.jpg | 2019-06-01 17:28 | 478K | |
![[IMG]](/icons/image2.gif) | Curt_Hodges_Draft Card pg 1.jpg | 2021-01-05 12:50 | 326K | |
![[IMG]](/icons/image2.gif) | Curt_Hodges_Draft Card pg 2.jpg | 2021-01-05 12:50 | 259K | |
![[IMG]](/icons/image2.gif) | Curt_Hodges_Inscription_2019.JPG | 2019-05-29 17:17 | 344K | |
![[IMG]](/icons/image2.gif) | Curt from family.JPG | 2019-12-18 14:41 | 32K | |
![[IMG]](/icons/image2.gif) | Curved Trawl Deck Structure.jpg | 2024-09-05 10:11 | 2.1M | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_0772.jpg | 2018-06-19 14:13 | 275K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_0981.jpg | 2018-06-19 14:18 | 159K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_0988.jpg | 2018-06-19 14:20 | 194K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_1157.jpg | 2018-06-19 14:22 | 186K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_1218.jpg | 2018-06-19 14:23 | 167K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_1292.jpg | 2018-06-19 14:25 | 200K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_1315.jpg | 2018-06-19 14:27 | 150K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_3054.jpg | 2018-06-19 14:32 | 166K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_3130.jpg | 2018-06-19 14:10 | 180K | |
![[IMG]](/icons/image2.gif) | DB_FWFWW_Eleanor1918_07072017_SITEIMAGE_3177.jpg | 2018-06-19 14:11 | 163K | |
![[IMG]](/icons/image2.gif) | DIscharge form Ancestry.jpg | 2020-12-14 17:50 | 4.1M | |
![[IMG]](/icons/image2.gif) | DONE_Bay Brick_REDUCE.jpg | 2021-01-15 17:22 | 840K | |
![[IMG]](/icons/image2.gif) | DONE_Bud Brick REDUCE.jpg | 2021-01-15 14:15 | 949K | |
![[IMG]](/icons/image2.gif) | DONE_COOPEY BRICK reduce.jpg | 2021-01-15 14:09 | 844K | |
![[IMG]](/icons/image2.gif) | DONE_Chicago brick REDUCE.jpg | 2021-01-15 14:12 | 841K | |
![[IMG]](/icons/image2.gif) | DONE_Coopey BRICK 2 REDUCE.jpg | 2021-01-15 14:11 | 1.0M | |
![[IMG]](/icons/image2.gif) | DONE_Daughdrill brick REDUCE.jpg | 2021-01-15 08:48 | 739K | |
![[IMG]](/icons/image2.gif) | DONE_Dave brick REDUCE.jpg | 2021-01-15 14:13 | 837K | |
![[IMG]](/icons/image2.gif) | DONE_Dodd grave REDUCE.jpg | 2021-01-15 08:46 | 948K | |
![[IMG]](/icons/image2.gif) | DONE_Dooling brick REDUCE.jpg | 2021-01-15 08:47 | 894K | |
![[IMG]](/icons/image2.gif) | DONE_Dransart in Webbs file REDUCE.jpg | 2021-01-15 14:59 | 69K | |
![[IMG]](/icons/image2.gif) | DONE_Draper brick REDUCE.jpg | 2021-01-15 13:53 | 803K | |
![[IMG]](/icons/image2.gif) | DONE_EUGENE REDUCE IMG_8768.jpg | 2021-01-15 14:30 | 883K | |
![[IMG]](/icons/image2.gif) | DONE_Elam brick REDUCE IMG_20200620_143215.jpg | 2021-01-15 14:01 | 876K | |
![[IMG]](/icons/image2.gif) | DONE_Elly Lulu Bob and Ann Group REDUCE IMG_20200306_113624.jpg | 2021-01-15 14:29 | 963K | |
![[IMG]](/icons/image2.gif) | DONE_FINN IMG_0746 end of now in small wall_REDUCE.jpg | 2021-01-15 14:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | DONE_Finn_wall brick_REDUCE.jpg | 2021-01-15 14:06 | 958K | |
![[IMG]](/icons/image2.gif) | DONE_Finneran Wife Genevieve_REDUCE.jpg | 2021-01-15 14:06 | 887K | |
![[IMG]](/icons/image2.gif) | DONE_Friel brick_REDUCE.jpg | 2021-01-15 14:16 | 791K | |
![[IMG]](/icons/image2.gif) | DONE_GREENWALD in situ REDUCE.jpg | 2021-01-15 14:54 | 803K | |
![[IMG]](/icons/image2.gif) | DONE_Golden Grave REDUCE.jpg | 2021-01-15 14:17 | 922K | |
![[IMG]](/icons/image2.gif) | DONE_Golden bricks REDUCE.jpg | 2021-01-15 14:16 | 946K | |
![[IMG]](/icons/image2.gif) | DONE_Greenwald Brick_Soton_Collection_2019_REDUCE.jpg | 2021-01-15 14:31 | 893K | |
![[IMG]](/icons/image2.gif) | DONE_Groth Newspaper Article REDUCE.jpg | 2021-01-15 15:32 | 733K | |
![[IMG]](/icons/image2.gif) | DONE_Groth_B&W Photo REDUCE.jpg | 2021-01-15 14:26 | 809K | |
![[IMG]](/icons/image2.gif) | DONE_HAMMOND BRICK 20200306_114154 REDUCE.jpg | 2021-01-15 14:31 | 846K | |
![[IMG]](/icons/image2.gif) | DONE_HARVEY NEWSPAPER REDUCE.jpg | 2021-01-15 15:30 | 846K | |
![[IMG]](/icons/image2.gif) | DONE_HELMLING BRICK IMG_20181213_145124070 edited REDUCE.jpg | 2021-01-15 14:32 | 1.0M | |
![[IMG]](/icons/image2.gif) | DONE_HENLEY BRICK IMG_20200620_152912 EDITED REDUCE.jpg | 2021-01-15 14:33 | 968K | |
![[IMG]](/icons/image2.gif) | DONE_HODGES BRICK REDUCE.jpg | 2021-01-15 14:27 | 819K | |
![[IMG]](/icons/image2.gif) | DONE_HODGES NEWSPAPER REDUCE.jpg | 2021-01-15 14:27 | 846K | |
![[IMG]](/icons/image2.gif) | DONE_Heatherington headstone REDUCE.jpg | 2021-01-19 09:57 | 244K | |
![[IMG]](/icons/image2.gif) | DONE_IRR IMG_20200620_152804 REDUCE.jpg | 2021-01-15 14:34 | 752K | |
![[IMG]](/icons/image2.gif) | DONE_JOHNSON FF BRICK IMG_8766 edited REDUCE.jpg | 2021-01-15 14:35 | 843K | |
![[IMG]](/icons/image2.gif) | DONE_JOHNSON JOHNNY BRICK 20200306_114816 EDITED REDUCE.jpg | 2021-01-15 14:36 | 943K | |
![[IMG]](/icons/image2.gif) | DONE_Jones Brick 2 ARROW CHARSTON SC REDUCE.jpg | 2021-01-15 14:37 | 898K | |
![[IMG]](/icons/image2.gif) | DONE_Jones Brick WET IMG_20200620_154440 REDUCE.jpg | 2021-01-15 14:36 | 929K | |
![[IMG]](/icons/image2.gif) | DONE_KNIGHT BRICK EDITED IMG_8748 REDUCE.jpg | 2021-01-15 15:46 | 1.0M | |
![[IMG]](/icons/image2.gif) | DONE_Kelly Brick reduce.jpg | 2021-01-15 14:38 | 812K | |
![[IMG]](/icons/image2.gif) | DONE_LAWRENCE BRICK IMG_20200306_121329 edted REDUCE.jpg | 2021-01-15 14:47 | 835K | |
![[IMG]](/icons/image2.gif) | DONE_MARTIN BRICK IMG_8812 REDUCE.jpg | 2021-01-15 15:46 | 882K | |
![[IMG]](/icons/image2.gif) | DONE_MASON BRICK 2 ILL 20200306_114242 EDITED REDUCE.jpg | 2021-01-15 14:42 | 827K | |
![[IMG]](/icons/image2.gif) | DONE_MASON JOE BRICK IMG_20200306_120824 EDITED REDUCE.jpg | 2021-01-15 14:42 | 956K | |
![[IMG]](/icons/image2.gif) | DONE_MATHIS BRICK IMG-20200620 EDITED REDUCE.jpg | 2021-01-15 14:39 | 936K | |
![[IMG]](/icons/image2.gif) | DONE_METZ RECORD MR WEBB REDUCE.jpg | 2021-01-15 15:00 | 111K | |
![[IMG]](/icons/image2.gif) | DONE_MEYER BRICK IMG_20200620_151457 EDITED REDUCE.jpg | 2021-01-15 14:44 | 960K | |
![[IMG]](/icons/image2.gif) | DONE_MEYER GRAVE REDUCE.jpg | 2021-01-15 15:48 | 745K | |
![[IMG]](/icons/image2.gif) | DONE_MOORE BRICK IN SITU REDUCE.jpg | 2021-01-15 14:58 | 803K | |
![[IMG]](/icons/image2.gif) | DONE_MOORE WEBB RECORD REDUCE.jpg | 2021-01-15 14:59 | 127K | |
![[IMG]](/icons/image2.gif) | DONE_MORGAN BRICK IMG_20200116_094043 REDUCE.jpg | 2021-01-15 14:46 | 866K | |
![[IMG]](/icons/image2.gif) | DONE_MORRIS BRICK IMG_20200620_155129 EDITED REDUCE.jpg | 2021-01-15 14:45 | 800K | |
![[IMG]](/icons/image2.gif) | DONE_MULELLER BRICK IMG_20200620_152925 EDITED REDUCE.jpg | 2021-01-15 14:47 | 854K | |
![[IMG]](/icons/image2.gif) | DONE_ODOM BRICK IMG_20200306_121259 EDITED REDUCE.jpg | 2021-01-15 14:48 | 852K | |
![[IMG]](/icons/image2.gif) | DONE_RECINE BRICK 1 IMG_20200116_094406 edited REDUCE.jpg | 2021-01-15 15:43 | 965K | |
![[IMG]](/icons/image2.gif) | DONE_RECINE BRICK 2 EDITED REDUCE.jpg | 2021-01-15 15:44 | 870K | |
![[IMG]](/icons/image2.gif) | DONE_ROBY BRICK IMG_20200306_121551 REDUCE.jpg | 2021-01-15 15:07 | 887K | |
![[IMG]](/icons/image2.gif) | DONE_ROSCOE BRICK IN SITU REDUCE.jpg | 2021-01-15 14:58 | 803K | |
![[IMG]](/icons/image2.gif) | DONE_SHIRK BRICK IMG_8398 REDUCE.jpg | 2021-01-15 14:49 | 917K | |
![[IMG]](/icons/image2.gif) | DONE_SLATER BRICK IMG_8796 REDUCE.jpg | 2021-01-15 14:50 | 841K | |
![[IMG]](/icons/image2.gif) | DONE_SMITH BRICK IMG_20200306_121446 REDUCE.jpg | 2021-01-15 14:52 | 819K | |
![[IMG]](/icons/image2.gif) | DONE_SMITH ROBERT BRICK 20200306_114647 REDUCE.jpg | 2021-01-15 14:52 | 963K | |
![[IMG]](/icons/image2.gif) | DONE_URBAN BRICK IMG_20200620_153132 REDUCE.jpg | 2021-01-15 14:49 | 898K | |
![[IMG]](/icons/image2.gif) | DONE_Urban Grave 75th Commemoration REDUCE.jpg | 2021-01-15 15:16 | 761K | |
![[IMG]](/icons/image2.gif) | DONE_VANCE BRICK 1 REDUCE.jpg | 2021-01-15 15:13 | 738K | |
![[IMG]](/icons/image2.gif) | DONE_VANCE BRICK 2 REDUCE.jpg | 2021-01-15 15:12 | 832K | |
![[IMG]](/icons/image2.gif) | DONE_VAUGHN BRICK IN SITU REDUCE.jpg | 2021-01-15 14:57 | 803K | |
![[IMG]](/icons/image2.gif) | DONE_WELLS NEWSPAPER REDUCE_.jpg | 2021-01-15 15:41 | 931K | |
![[IMG]](/icons/image2.gif) | DONE_WEMPEN BRICK COLLECTIONS FEB 25 IMG_0751 REDUCE.jpg | 2021-01-15 15:22 | 751K | |
![[IMG]](/icons/image2.gif) | DONE_WEMPEN BRICK COLLECTIONS IMG_0752 Feb 45 REDUCE.jpg | 2021-01-15 15:21 | 965K | |
![[IMG]](/icons/image2.gif) | DONE_WEMPEN BRICK COLLECTIONS MD IMG_0745 MD REDUCE.jpg | 2021-01-15 15:20 | 953K | |
![[IMG]](/icons/image2.gif) | DONE_WEMPEN BRICK IMG_8811 Wm M REDUCE.jpg | 2021-01-15 15:17 | 943K | |
![[IMG]](/icons/image2.gif) | DONE_WEMPEN BRICK NOW REDUCE.jpg | 2021-01-15 15:18 | 919K | |
![[IMG]](/icons/image2.gif) | DONE_WEMPEN COLLECTIONS IMG_0742 double arrow see HER 1993.jpg | 2021-01-15 15:19 | 1.0M | |
![[IMG]](/icons/image2.gif) | DONE_WEMPEN HER11131 WIDE REDUCE.jpg | 2021-01-15 15:22 | 1.0M | |
![[IMG]](/icons/image2.gif) | DONE_WEST BRICK IMG_20200116_094226 REDUCE.jpg | 2021-01-15 15:37 | 944K | |
![[IMG]](/icons/image2.gif) | DONE_WEST BRICK RTI 2 REDUCE.jpg | 2021-01-15 15:39 | 877K | |
![[IMG]](/icons/image2.gif) | DONE_WEST BRICK RTI REDUCE.jpg | 2021-01-15 15:38 | 859K | |
![[IMG]](/icons/image2.gif) | DONE_WORDS BRICK RTI.jpg | 2021-01-15 15:09 | 959K | |
![[IMG]](/icons/image2.gif) | DONE_Words Wet bricks IMG_20200917_125640 REDUCE.jpg | 2021-01-15 15:10 | 831K | |
![[IMG]](/icons/image2.gif) | DONE_taylor brick 20200306_103819 reduce.jpg | 2021-01-15 15:06 | 816K | |
![[IMG]](/icons/image2.gif) | DW Smith.png | 2019-09-12 15:14 | 21K | |
![[IMG]](/icons/image2.gif) | DW SmithWB.png | 2020-12-16 12:53 | 25K | |
![[IMG]](/icons/image2.gif) | DW_Smith_inscription_2019.JPG | 2019-05-29 17:21 | 220K | |
![[IMG]](/icons/image2.gif) | DW_Smith_inscription_2019.jpg | 2019-06-01 17:21 | 506K | |
![[IMG]](/icons/image2.gif) | Dagon.png | 2018-11-19 13:43 | 3.4M | |
![[IMG]](/icons/image2.gif) | Dartmeet.png | 2018-07-05 15:46 | 5.7M | |
![[IMG]](/icons/image2.gif) | Daughdrill Fold3_Page_1.jpg | 2020-12-15 16:38 | 490K | |
![[IMG]](/icons/image2.gif) | Daughdrill Fold3_Page_2.jpg | 2020-12-15 16:40 | 438K | |
![[IMG]](/icons/image2.gif) | Dave_Ray_Inscription_2019.jpg | 2019-06-01 17:23 | 556K | |
![[IMG]](/icons/image2.gif) | David Vance Brigham Young University Year Book 1939 aged 20.JPG | 2019-12-18 15:20 | 55K | |
![[IMG]](/icons/image2.gif) | DeFontaine Bathymetry 2015.png | 2018-09-06 15:12 | 845K | |
![[IMG]](/icons/image2.gif) | Delbert_Smith_ServiceCardFront.jpg | 2021-01-05 11:09 | 411K | |
![[IMG]](/icons/image2.gif) | Delbert_Smith_ServiceCardReverse.jpg | 2021-01-05 11:09 | 385K | |
![[IMG]](/icons/image2.gif) | Delbert smith 3rd from left.jpg | 2019-12-19 10:46 | 101K | |
![[IMG]](/icons/image2.gif) | Delbert with annotation.jpg | 2020-12-16 12:57 | 69K | |
![[IMG]](/icons/image2.gif) | Distinctive Bilge Keel Feature.jpg | 2024-09-05 10:11 | 532K | |
![[IMG]](/icons/image2.gif) | Dooling Draft Card Pg 1.jpg | 2021-01-05 14:02 | 213K | |
![[IMG]](/icons/image2.gif) | Dooling Draft Card Pg 2.jpg | 2021-01-05 14:02 | 166K | |
![[IMG]](/icons/image2.gif) | Dooling brick edited.jpg | 2021-01-05 13:59 | 5.0M | |
![[IMG]](/icons/image2.gif) | Dooling brick edited_REDUCE.jpg | 2021-01-15 08:44 | 5.0M | |
![[IMG]](/icons/image2.gif) | Dow Draper.jpg | 2021-01-07 09:42 | 48K | |
![[IMG]](/icons/image2.gif) | Draft Card Side 1.jpg | 2020-12-16 11:32 | 277K | |
![[IMG]](/icons/image2.gif) | Draft Card Side 2.jpg | 2020-12-16 11:33 | 318K | |
![[IMG]](/icons/image2.gif) | Draft Card_Roby.jpg | 2021-01-08 18:05 | 361K | |
![[IMG]](/icons/image2.gif) | Draft Card pg 1.jpg | 2021-03-11 15:31 | 219K | |
![[IMG]](/icons/image2.gif) | Draft Card pg 1_V2.jpg | 2020-12-21 15:00 | 152K | |
![[IMG]](/icons/image2.gif) | Draft Card pg 2.jpg | 2021-03-11 15:32 | 189K | |
![[IMG]](/icons/image2.gif) | Draft Card pg 2_Groth.JPG | 2021-01-15 15:33 | 78K | |
![[IMG]](/icons/image2.gif) | Draft Card pg 2_V2.jpg | 2020-12-21 15:00 | 123K | |
![[IMG]](/icons/image2.gif) | Draft Card reverse_Roby.jpg | 2021-01-08 18:06 | 335K | |
![[IMG]](/icons/image2.gif) | Draft Service_Card_Christensen_1.JPG | 2020-12-14 18:20 | 166K | |
![[IMG]](/icons/image2.gif) | Draft Service_Card_Christensen_2.JPG | 2020-12-14 18:23 | 83K | |
![[IMG]](/icons/image2.gif) | Draft card pg 1.jpg | 2020-12-14 17:45 | 790K | |
![[IMG]](/icons/image2.gif) | Draft card pg 2.jpg | 2020-12-14 17:48 | 776K | |
![[IMG]](/icons/image2.gif) | Dransart, Jules Joseph (1919) Draft Card pg 1.jpg | 2021-01-05 14:06 | 289K | |
![[IMG]](/icons/image2.gif) | Dransart Draft Card pg 2.jpg | 2021-01-05 14:07 | 177K | |
![[IMG]](/icons/image2.gif) | Dransart Grave.jpeg | 2021-01-05 14:09 | 321K | |
![[IMG]](/icons/image2.gif) | Dransart in Webbs file.jpg | 2021-01-05 14:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | Draper Draft Card pg 1.jpg | 2021-01-07 09:40 | 298K | |
![[IMG]](/icons/image2.gif) | Draper draft Card pg 2.jpg | 2021-01-07 09:40 | 245K | |
![[IMG]](/icons/image2.gif) | Dux Bathymetry 2011.png | 2018-10-08 11:30 | 674K | |
![[IMG]](/icons/image2.gif) | East Point.png | 2018-07-05 15:50 | 456K | |
![[IMG]](/icons/image2.gif) | EastPoint_Engine_DRobinsin.jpg | 2019-05-02 09:50 | 74K | |
![[IMG]](/icons/image2.gif) | EastPoint_Prop_DRobinson.jpg | 2019-05-02 09:50 | 140K | |
![[IMG]](/icons/image2.gif) | EastPoint_Steering_Quadrant_DRobinson.jpg | 2019-05-02 09:51 | 74K | |
![[IMG]](/icons/image2.gif) | Eatherington Draft Card Pg 1.jpg | 2021-04-20 09:24 | 246K | |
![[IMG]](/icons/image2.gif) | Eatherington Draft Card Pg 2.jpg | 2021-04-20 09:24 | 233K | |
![[IMG]](/icons/image2.gif) | Eatherington photo.png | 2021-04-20 09:29 | 53K | |
![[IMG]](/icons/image2.gif) | Eddie Meyer Draft Card Page 1.jpg | 2020-12-16 11:39 | 274K | |
![[IMG]](/icons/image2.gif) | Eddie Meyer Draft Card Page 2.jpg | 2020-12-16 11:40 | 239K | |
![[IMG]](/icons/image2.gif) | Eddie_Meyer_Inscription_2019.jpg | 2019-06-01 17:27 | 628K | |
![[IMG]](/icons/image2.gif) | Eddie_Meyer_inscription_2019.jpg | 2019-05-29 17:23 | 420K | |
![[IMG]](/icons/image2.gif) | Egero Bathymetry 2009.png | 2018-10-08 12:07 | 477K | |
![[IMG]](/icons/image2.gif) | Eleanor-001_Wendes.jpg | 2018-06-19 14:54 | 458K | |
![[IMG]](/icons/image2.gif) | Eleanor_SSS_NavitusBay1.jpg | 2018-10-10 10:17 | 217K | |
![[IMG]](/icons/image2.gif) | Ella Sayer Bathymetry 2015.png | 2018-08-31 15:08 | 559K | |
![[IMG]](/icons/image2.gif) | Elsa.png | 2018-07-26 14:17 | 4.4M | |
![[IMG]](/icons/image2.gif) | Engine 01 - tony badham.jpg | 2018-10-29 12:40 | 84K | |
![[IMG]](/icons/image2.gif) | Enrico Parodi Bathymetry 2011.png | 2018-10-08 11:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | Erato.png | 2018-07-05 15:53 | 2.6M | |
![[IMG]](/icons/image2.gif) | Ernest Legouve Barque Shadwell Dock for Buenos Aires 1917.jpg | 2018-10-09 11:33 | 140K | |
![[IMG]](/icons/image2.gif) | ExcellencePleske Bathymetry 2016.png | 2018-09-06 15:14 | 917K | |
![[IMG]](/icons/image2.gif) | FOLD3_Service_Registration_Card_Glenn_Bunker_1.JPG | 2020-12-15 14:27 | 238K | |
![[IMG]](/icons/image2.gif) | FOLD3_Service_Registration_Card_Glenn_Bunker_2.JPG | 2020-12-15 14:29 | 111K | |
![[IMG]](/icons/image2.gif) | FRIEL_Inscription_2019.jpg | 2019-05-29 17:24 | 392K | |
![[IMG]](/icons/image2.gif) | FW659_14072017_SITEIMAGE_01_17.jpg | 2018-06-04 11:30 | 237K | |
![[IMG]](/icons/image2.gif) | FWFWW_49_19072017_SITEIMAGE_001.jpg | 2018-08-02 15:10 | 79K | |
![[IMG]](/icons/image2.gif) | FWFWW_49_19072017_SITEIMAGE_002.jpg | 2018-08-02 15:15 | 49K | |
![[IMG]](/icons/image2.gif) | FWFWW_49_19072017_SITEIMAGE_004.jpg | 2018-08-02 15:20 | 45K | |
![[IMG]](/icons/image2.gif) | FWFWW_49_19072017_SITEIMAGE_011.jpg | 2018-08-02 15:30 | 33K | |
![[IMG]](/icons/image2.gif) | FWFWW_49_19072017_SITEIMAGE_012.jpg | 2018-08-02 15:34 | 45K | |
![[IMG]](/icons/image2.gif) | FWFWW_49_19072017_SITEIMAGE_014.jpg | 2018-08-02 15:38 | 38K | |
![[IMG]](/icons/image2.gif) | FWFWW_49_19072017_SITEIMAGE_021.jpg | 2018-08-02 15:41 | 29K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_4_2.jpg | 2018-06-04 12:51 | 134K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9144.jpg | 2018-06-04 12:54 | 285K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9201.jpg | 2018-06-04 12:54 | 250K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9259.jpg | 2018-06-04 12:55 | 281K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9344.jpg | 2018-06-04 12:56 | 254K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9422.jpg | 2018-06-04 12:57 | 236K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9449.jpg | 2018-06-04 12:57 | 220K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9496.jpg | 2018-06-04 12:58 | 200K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9571.jpg | 2018-06-04 12:59 | 276K | |
![[IMG]](/icons/image2.gif) | FWFWW_474_20150624_IMAGE_9665.jpg | 2018-06-04 12:59 | 213K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_01.jpg | 2018-06-04 11:33 | 237K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_02.jpg | 2018-06-04 11:34 | 32K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_03.jpg | 2018-06-04 11:36 | 129K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_04.jpg | 2018-06-04 11:40 | 125K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_05.jpg | 2018-06-04 11:46 | 146K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_06.jpg | 2018-06-04 11:48 | 144K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_07.jpg | 2018-06-04 11:49 | 146K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_08.jpg | 2018-06-04 11:51 | 139K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_09.jpg | 2018-06-04 11:52 | 140K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_10.jpg | 2018-06-04 11:54 | 132K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_11.jpg | 2018-06-04 11:55 | 135K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_12.jpg | 2018-06-04 11:56 | 110K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_13.jpg | 2018-06-04 11:57 | 161K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_14.jpg | 2018-06-04 12:02 | 60K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_15.jpg | 2018-06-04 12:03 | 141K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_16.jpg | 2018-06-04 12:04 | 158K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_17.jpg | 2018-06-04 12:05 | 181K | |
![[IMG]](/icons/image2.gif) | FWFWW_659_14072017_SITEIMAGE_18.jpg | 2018-06-04 12:06 | 142K | |
![[IMG]](/icons/image2.gif) | FWFWW_2228_28082015_SITEIMAGE_4.jpg | 2018-10-11 16:42 | 86K | |
![[IMG]](/icons/image2.gif) | FWFWW_2228_28082015_SITEIMAGE_7.jpg | 2018-10-11 16:43 | 90K | |
![[IMG]](/icons/image2.gif) | FWFWW_2228_28082015_SITEIMAGE_33.jpg | 2018-10-11 16:44 | 96K | |
![[IMG]](/icons/image2.gif) | FWFWW_2228_28082015_SITEIMAGE_45.jpg | 2018-10-11 16:45 | 103K | |
![[IMG]](/icons/image2.gif) | FWFWW_Arfon_19052016_SITEIMAGE_MAT_MED_1264_med.jpg | 2018-10-11 15:42 | 135K | |
![[IMG]](/icons/image2.gif) | FWFWW_Arfon_19052016_SITEIMAGE_MED_1206.jpg | 2018-10-11 15:43 | 144K | |
![[IMG]](/icons/image2.gif) | FWFWW_Arfon_19052016_SITEIMAGE_MED_1245.jpg | 2018-10-11 15:44 | 156K | |
![[IMG]](/icons/image2.gif) | FWFWW_Arfon_19052016_SITEIMAGE_MED_1310.jpg | 2018-10-11 15:45 | 110K | |
![[IMG]](/icons/image2.gif) | FWFWW_Azemmour_29112014_SITEIMAGE_HWT_4725.jpg | 2018-08-28 11:46 | 83K | |
![[IMG]](/icons/image2.gif) | FWFWW_Azemmour_29112014_SITEIMAGE_HWT_4728.jpg | 2018-08-28 11:46 | 104K | |
![[IMG]](/icons/image2.gif) | FWFWW_Azemmour_29112014_SITEIMAGE_HWT_4729.jpg | 2018-08-28 11:46 | 72K | |
![[IMG]](/icons/image2.gif) | FWFWW_Azemmour_29112014_SITEIMAGE_HWT_4733.jpg | 2018-08-28 11:46 | 109K | |
![[IMG]](/icons/image2.gif) | FWFWW_Azemmour_29112014_SITEIMAGE_HWT_4734.jpg | 2018-08-28 11:46 | 79K | |
![[IMG]](/icons/image2.gif) | FWFWW_Azemmour_29112014_SITEPLAN_azemmour2011.jpg | 2018-08-28 11:46 | 52K | |
![[IMG]](/icons/image2.gif) | FWFWW_BentonCastle_05072016_SITEIMAGE_MED_3048.jpg | 2018-08-28 11:52 | 118K | |
![[IMG]](/icons/image2.gif) | FWFWW_BentonCastle_05072016_SITEIMAGE_MED_3056.jpg | 2018-08-28 11:52 | 139K | |
![[IMG]](/icons/image2.gif) | FWFWW_BentonCastle_05072016_SITEIMAGE_MED_3068.jpg | 2018-08-28 11:52 | 71K | |
![[IMG]](/icons/image2.gif) | FWFWW_BoltHead_27062016_SITEIMAGE_IMG_3156.jpg | 2018-08-28 12:00 | 307K | |
![[IMG]](/icons/image2.gif) | FWFWW_BoltHead_27062016_SITEIMAGE_IMG_3161.jpg | 2018-08-28 12:00 | 352K | |
![[IMG]](/icons/image2.gif) | FWFWW_BoltHead_27062016_SITEIMAGE_IMG_3162.jpg | 2018-08-28 12:00 | 291K | |
![[IMG]](/icons/image2.gif) | FWFWW_BoltHead_27062016_SITEIMAGE_IMG_3169.jpg | 2018-08-28 12:00 | 323K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_14122015_SITEIMAGE_HWT_4300.jpg | 2018-08-28 12:24 | 111K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_14122015_SITEIMAGE_HWT_4319.jpg | 2018-08-28 12:24 | 91K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_14122015_SITEIMAGE_HWT_4324.jpg | 2018-08-28 12:24 | 117K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_14122015_SITEIMAGE_HWT_4330.jpg | 2018-08-28 12:24 | 100K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_14122015_SITEIMAGE_HWT_4349.jpg | 2018-08-28 12:24 | 122K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_14122015_SITEIMAGE_HWT_4352.jpg | 2018-08-28 12:24 | 123K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_14122015_SITEIMAGE_HWT_4364.jpg | 2018-08-28 12:24 | 108K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5170.jpg | 2018-08-28 12:24 | 128K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5192.jpg | 2018-08-28 12:24 | 126K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5219.jpg | 2018-08-28 12:24 | 186K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5289.jpg | 2018-08-28 12:24 | 138K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5390.jpg | 2018-08-28 12:24 | 119K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5472.jpg | 2018-08-28 12:24 | 121K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5708.jpg | 2018-08-28 12:24 | 122K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5902.jpg | 2018-08-28 12:24 | 111K | |
![[IMG]](/icons/image2.gif) | FWFWW_Boxer_21072016_SITEIMAGE_MED_5945.jpg | 2018-08-28 12:24 | 109K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_IMG_2690 Pilots where the pilots lodged.jpg | 2018-08-28 12:54 | 187K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_IMG_2691 Power station for barrage balloons.jpg | 2018-08-28 12:54 | 311K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_SITEIMAGE_IMG_2647 ww1 seaplane rails.jpg | 2018-08-28 12:54 | 259K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_SITEIMAGE_IMG_2652 hooks for tying down flying boats.jpg | 2018-08-28 12:54 | 181K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_SITEIMAGE_IMG_2653 for tying down flying boats.jpg | 2018-08-28 12:54 | 203K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_SITEIMAGE_IMG_2654 degausing station.jpg | 2018-08-28 12:54 | 134K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_SITEIMAGE_IMG_2656 NAAFI hut now beach hut.jpg | 2018-08-28 12:54 | 180K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_SITEIMAGE_IMG_2662 ST Georges Chapel part of Eaglehurst Camp.jpg | 2018-08-28 12:54 | 168K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_25012017_SITEIMAGE_IMG_2684.jpg | 2018-08-28 12:54 | 186K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9690.jpg | 2018-08-28 12:54 | 145K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9696.jpg | 2018-08-28 12:54 | 209K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9716.jpg | 2018-08-28 12:54 | 240K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9729.jpg | 2018-08-28 12:54 | 135K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9737.jpg | 2018-08-28 12:54 | 199K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9743.jpg | 2018-08-28 12:54 | 160K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9753.jpg | 2018-08-28 12:54 | 187K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9760.jpg | 2018-08-28 12:54 | 164K | |
![[IMG]](/icons/image2.gif) | FWFWW_CalshotSeaplanes_29112014_IMG_9763.jpg | 2018-08-28 12:54 | 139K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_15082016_SITEIMAGE_DSC_9566_MPitts_Bow.jpg | 2018-08-28 13:17 | 99K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_15082016_SITEIMAGE_DSC_9601_MPitts_upright_boiler.jpg | 2018-08-28 13:16 | 106K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_15082016_SITEIMAGE_DSC_9616MPitts_frames.jpg | 2018-08-28 13:16 | 103K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_15082016_SITEIMAGE_DSC_9622_MPitts_forward_winch.jpg | 2018-08-28 13:16 | 107K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_15082016_SITEIMAGE_DSC_9625_MPitts_forward_winch.jpg | 2018-08-28 13:16 | 105K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_15082016_SITEIMAGE_HWT_3579_broken ceramics.jpg | 2018-08-28 13:16 | 174K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0591.jpg | 2018-08-28 13:16 | 128K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0613.jpg | 2018-08-28 13:16 | 145K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0641.jpg | 2018-08-28 13:16 | 121K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0649.jpg | 2018-08-28 13:16 | 115K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0666.jpg | 2018-08-28 13:16 | 176K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0678.jpg | 2018-08-28 13:16 | 117K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0701.jpg | 2018-08-28 13:16 | 143K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_A7K0746.jpg | 2018-08-28 13:16 | 156K | |
![[IMG]](/icons/image2.gif) | FWFWW_Camberwell_19062018_SITEIMAGE_B7K8936.jpg | 2018-08-28 13:16 | 103K | |
![[IMG]](/icons/image2.gif) | FWFWW_CulverCliff_26042017_SITEIMAGE_IMG_4551.jpg | 2018-10-11 15:50 | 230K | |
![[IMG]](/icons/image2.gif) | FWFWW_CulverCliff_26042017_SITEIMAGE_IMG_4552.jpg | 2018-10-11 15:50 | 180K | |
![[IMG]](/icons/image2.gif) | FWFWW_CulverCliff_26042017_SITEIMAGE_IMG_4562.jpg | 2018-10-11 15:50 | 174K | |
![[IMG]](/icons/image2.gif) | FWFWW_Dagon_14032018_SITEIMAGE_Dagon_Gun_on_pedestal.jpg | 2018-10-11 15:52 | 126K | |
![[IMG]](/icons/image2.gif) | FWFWW_Dagon_30042018_SITEIMAGE_Dagon_Boiler_and_steam_pipes.jpg | 2018-10-11 15:53 | 177K | |
![[IMG]](/icons/image2.gif) | FWFWW_Dagon_30042018_SITEIMAGE_Dagon_Broken_bow.jpg | 2018-10-11 15:54 | 117K | |
![[IMG]](/icons/image2.gif) | FWFWW_Dagon_30042018_SITEIMAGE_Dagon_stern_next_to_rudder.jpg | 2018-10-11 15:54 | 180K | |
![[IMG]](/icons/image2.gif) | FWFWW_Defiance_24072017_SITEIMAGE_1994.jpg | 2018-08-13 14:46 | 92K | |
![[IMG]](/icons/image2.gif) | FWFWW_Defiance_24072017_SITEIMAGE_2006.jpg | 2018-08-13 14:46 | 62K | |
![[IMG]](/icons/image2.gif) | FWFWW_Defiance_24072017_SITEIMAGE_5589.jpg | 2018-08-13 14:46 | 98K | |
![[IMG]](/icons/image2.gif) | FWFWW_Defiance_24072017_SITEIMAGE_5600.jpg | 2018-08-13 14:46 | 98K | |
![[IMG]](/icons/image2.gif) | FWFWW_Defiance_24072017_SITEIMAGE_5603.jpg | 2018-08-13 14:46 | 91K | |
![[IMG]](/icons/image2.gif) | FWFWW_Effort_29062016_SITEIMAGE_P1010297.jpg | 2018-08-22 12:06 | 340K | |
![[IMG]](/icons/image2.gif) | FWFWW_Effort_29062016_SITEIMAGE_P1010299.jpg | 2018-08-22 12:06 | 210K | |
![[IMG]](/icons/image2.gif) | FWFWW_Effort_29062016_SITEIMAGE_P1010305.jpg | 2018-08-22 12:06 | 345K | |
![[IMG]](/icons/image2.gif) | FWFWW_Effort_29062016_SITEIMAGE_P1010313.jpg | 2018-08-22 12:06 | 203K | |
![[IMG]](/icons/image2.gif) | FWFWW_EmpressQueen_13012016_SITEIMAGE_Emp_Queen_Diver.jpg | 2018-10-11 15:56 | 100K | |
![[IMG]](/icons/image2.gif) | FWFWW_EmpressQueen_13012016_SITEIMAGE_Emp_Queen_Round_feature.jpg | 2018-10-11 15:56 | 127K | |
![[IMG]](/icons/image2.gif) | FWFWW_EmpressQueen_13012016_SITEIMAGE_Emp_Queen_feature_with_holes.jpg | 2018-10-11 15:56 | 143K | |
![[IMG]](/icons/image2.gif) | FWFWW_EmpressQueen_13012016_SITEIMAGE_Emp_Queen_tap_or_valve.jpg | 2018-10-11 15:57 | 117K | |
![[IMG]](/icons/image2.gif) | FWFWW_EmpressQueen_13012016_SITEIMAGE_Emp_Queen_view_into_struture.jpg | 2018-10-11 15:57 | 152K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_07082018_SITEPLAN_Ortho for site plan.jpg | 2018-08-22 12:46 | 93K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_28062016_SITEIMAGE_DSCF4402.jpg | 2018-08-22 12:46 | 209K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_28062016_SITEIMAGE_DSCF4408.jpg | 2018-08-22 12:46 | 216K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_28062016_SITEIMAGE_P1010050.jpg | 2018-08-22 12:46 | 175K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_30062016_SITEIMAGE_DJI_0506.jpg | 2018-08-22 12:46 | 160K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_30062016_SITEIMAGE_DJI_0521.jpg | 2018-08-22 12:46 | 138K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_30062016_SITEIMAGE_DJI_0625.jpg | 2018-08-22 12:46 | 150K | |
![[IMG]](/icons/image2.gif) | FWFWW_Esther[Irene]_30062016_SITEIMAGE_DJI_0641.jpg | 2018-08-22 12:46 | 144K | |
![[IMG]](/icons/image2.gif) | FWFWW_FieryCross_28062016_SITEIMAGE_P1010063.jpg | 2018-10-11 16:35 | 283K | |
![[IMG]](/icons/image2.gif) | FWFWW_FieryCross_28062016_SITEIMAGE_P1010102.jpg | 2018-10-11 16:36 | 264K | |
![[IMG]](/icons/image2.gif) | FWFWW_FieryCross_28062016_SITEIMAGE_P1010188.jpg | 2018-10-11 16:37 | 281K | |
![[IMG]](/icons/image2.gif) | FWFWW_FieryCross_28062016_SITEIMAGE_P1010212.jpg | 2018-10-11 16:38 | 262K | |
![[IMG]](/icons/image2.gif) | FWFWW_Glory_29062016_3DIMAGE_Glory_3D_model.jpg | 2018-08-22 12:16 | 93K | |
![[IMG]](/icons/image2.gif) | FWFWW_Glory_29062016_SITEIMAGE_P1010338.jpg | 2018-08-22 12:16 | 310K | |
![[IMG]](/icons/image2.gif) | FWFWW_Glory_29062016_SITEIMAGE_P1010353.jpg | 2018-08-22 12:16 | 295K | |
![[IMG]](/icons/image2.gif) | FWFWW_Glory_29062016_SITEIMAGE_P1010498.jpg | 2018-08-22 12:16 | 316K | |
![[IMG]](/icons/image2.gif) | FWFWW_Glory_29062016_SITEIMAGE_P1010536.jpg | 2018-08-22 12:16 | 292K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1518.jpg | 2018-08-28 13:37 | 217K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1523.jpg | 2018-08-28 13:37 | 214K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1526.jpg | 2018-08-28 13:37 | 240K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1535.jpg | 2018-08-28 13:37 | 256K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1539.jpg | 2018-08-28 13:37 | 240K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1592.jpg | 2018-08-28 13:37 | 261K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1598.jpg | 2018-08-28 13:37 | 266K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1621.jpg | 2018-08-28 13:37 | 264K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1658.jpg | 2018-08-28 13:37 | 272K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_07042017_SITEIMAGE_DSCF1669.jpg | 2018-08-28 13:38 | 226K | |
![[IMG]](/icons/image2.gif) | FWFWW_HambleSeaplaneLighter_18072017_SITEIMAGE_DJI_0009.jpg | 2018-08-28 13:37 | 278K | |
![[IMG]](/icons/image2.gif) | FWFWW_Hazelwood_16062017_SITEIMAGE_B7K6510.jpg | 2018-10-14 19:56 | 128K | |
![[IMG]](/icons/image2.gif) | FWFWW_Hazelwood_16062017_SITEIMAGE_B7K6574.jpg | 2018-10-14 19:58 | 95K | |
![[IMG]](/icons/image2.gif) | FWFWW_Hazelwood_16062017_SITEIMAGE_B7K6595.jpg | 2018-10-14 19:59 | 99K | |
![[IMG]](/icons/image2.gif) | FWFWW_Hazelwood_16062017_SITEIMAGE_B7K6701.jpg | 2018-10-14 20:00 | 119K | |
![[IMG]](/icons/image2.gif) | FWFWW_Hazelwood_16062017_SITEIMAGE_B7K6719.jpg | 2018-10-14 20:01 | 117K | |
![[IMG]](/icons/image2.gif) | FWFWW_Hazelwood_16062017_SITEIMAGE_B7K6867.jpg | 2018-10-14 20:02 | 121K | |
![[IMG]](/icons/image2.gif) | FWFWW_Horsea_02062016_SITEIMAGE_P1000014.jpg | 2018-08-22 12:30 | 272K | |
![[IMG]](/icons/image2.gif) | FWFWW_Horsea_02062016_SITEIMAGE_P1000105.jpg | 2018-08-22 12:30 | 278K | |
![[IMG]](/icons/image2.gif) | FWFWW_Horsea_02062016_SITEIMAGE_P1000345.jpg | 2018-08-22 12:30 | 214K | |
![[IMG]](/icons/image2.gif) | FWFWW_Horsea_02062016_SITEPLAN_Horsea_BoatHouse_Pier_SITEPLAN.jpg | 2018-08-22 12:30 | 77K | |
![[IMG]](/icons/image2.gif) | FWFWW_Horsea_02062016_SITEPLAN_Horsea all ww1.jpg | 2018-08-22 12:30 | 72K | |
![[IMG]](/icons/image2.gif) | FWFWW_JohnRoberts_26072017_SITEIMAGE_2367.jpg | 2018-08-13 15:03 | 101K | |
![[IMG]](/icons/image2.gif) | FWFWW_JohnRoberts_26072017_SITEIMAGE_2516.jpg | 2018-08-13 15:03 | 100K | |
![[IMG]](/icons/image2.gif) | FWFWW_JohnRoberts_26072017_SITEIMAGE_7218.jpg | 2018-08-13 15:03 | 97K | |
![[IMG]](/icons/image2.gif) | FWFWW_JohnRoberts_26072017_SITEIMAGE_7479.jpg | 2018-08-13 15:03 | 82K | |
![[IMG]](/icons/image2.gif) | FWFWW_KingswearCastle_06062018_SITEPLAN_KingswearCastle_site plan.jpg | 2018-08-22 12:55 | 43K | |
![[IMG]](/icons/image2.gif) | FWFWW_KingswearCastle_29062016_SITEIMAGE_P6290034.jpg | 2018-08-22 12:55 | 255K | |
![[IMG]](/icons/image2.gif) | FWFWW_KingswearCastle_29062016_SITEIMAGE_P6290155.jpg | 2018-08-22 12:55 | 230K | |
![[IMG]](/icons/image2.gif) | FWFWW_KingswearCastle_30062016_SITEIMAGE_DSCF3415.jpg | 2018-08-22 12:55 | 221K | |
![[IMG]](/icons/image2.gif) | FWFWW_Kurland_03082018_SITEIMAGE_A7K1365_intact part of hull.jpg | 2018-08-22 13:03 | 154K | |
![[IMG]](/icons/image2.gif) | FWFWW_Kurland_03082018_SITEIMAGE_B7K9567_horseshoe cargo.jpg | 2018-08-22 13:03 | 142K | |
![[IMG]](/icons/image2.gif) | FWFWW_Kurland_30072018_SITEIMAGE_A7K0797_Kurland_cargo_canisters.jpg | 2018-08-22 13:03 | 150K | |
![[IMG]](/icons/image2.gif) | FWFWW_Kurland_30072018_SITEPLAN_Kurlands triple expansion engine_copyright Andy Williams.jpg | 2018-08-22 13:03 | 129K | |
![[IMG]](/icons/image2.gif) | FWFWW_LelantQuay_31122016_SITEIMAGE_Northern_Cleat_DSCF8191.jpg | 2018-10-14 20:14 | 230K | |
![[IMG]](/icons/image2.gif) | FWFWW_LelantQuay_31122016_SITEIMAGE_Northern_DJI_0685.jpg | 2018-10-14 20:16 | 252K | |
![[IMG]](/icons/image2.gif) | FWFWW_LelantQuay_31122016_SITEIMAGE_Northern_DSCF8181.jpg | 2018-10-14 20:16 | 193K | |
![[IMG]](/icons/image2.gif) | FWFWW_LelantQuay_31122016_SITEIMAGE_Northern_Rivets_DSCF8159.jpg | 2018-10-14 20:17 | 236K | |
![[IMG]](/icons/image2.gif) | FWFWW_LelantQuay_31122016_SITEIMAGE_Southern Section_3.jpg | 2018-10-14 20:18 | 197K | |
![[IMG]](/icons/image2.gif) | FWFWW_Leon_08082018_SITEIMAGE_A7K1823_Sbd vertical boiler lying next to hrizontal boiler.jpg | 2018-08-22 13:11 | 138K | |
![[IMG]](/icons/image2.gif) | FWFWW_Leon_19062018_SITEIMAGE_A7K1638_Anchor winch with anchor chain.jpg | 2018-08-22 13:11 | 142K | |
![[IMG]](/icons/image2.gif) | FWFWW_Leon_19062018_SITEIMAGE_A7K1745_Condenser.jpg | 2018-08-22 13:11 | 150K | |
![[IMG]](/icons/image2.gif) | FWFWW_Leon_19062018_SITEIMAGE_A7K1811_Condenser close up.jpg | 2018-08-22 13:11 | 188K | |
![[IMG]](/icons/image2.gif) | FWFWW_Leon_19062018_SITEIMAGE_A7K1830_Port side boiler.jpg | 2018-08-22 13:11 | 148K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0734.jpg | 2018-09-27 17:23 | 175K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0738.jpg | 2018-09-27 17:25 | 200K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0739.jpg | 2018-09-27 17:26 | 150K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0743.jpg | 2018-09-27 17:29 | 177K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0744.jpg | 2018-09-27 17:30 | 174K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0747.jpg | 2018-09-27 17:32 | 190K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0753.jpg | 2018-09-27 17:34 | 205K | |
![[IMG]](/icons/image2.gif) | FWFWW_LittlehamptonPort_26022016_SITEIMAGE_IMG_0754.jpg | 2018-09-27 17:35 | 183K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4794_Sara & shot_2.jpg | 2018-08-28 13:59 | 97K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4799.jpg | 2018-08-28 13:59 | 85K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4801.jpg | 2018-08-28 13:59 | 90K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4809_prop shaft tunnel arch_1.jpg | 2018-08-28 13:59 | 92K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4811_donkey boiler_1.jpg | 2018-08-28 13:59 | 85K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4813_bollards.jpg | 2018-08-28 13:59 | 93K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4814_cargo winch_1.jpg | 2018-08-28 13:59 | 90K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4817_anchor winch_3.jpg | 2018-08-28 13:59 | 88K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4826_cargo winch_3.jpg | 2018-08-28 13:59 | 96K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4830_donkey boiler & port boiler.jpg | 2018-08-28 13:59 | 79K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4835_front cylinder of engine & main boilers.jpg | 2018-08-28 13:59 | 82K | |
![[IMG]](/icons/image2.gif) | FWFWW_Londonier_28112014_SITEIMAGE_HWT_4843_stern gun_2.jpg | 2018-08-28 13:59 | 102K | |
![[IMG]](/icons/image2.gif) | FWFWW_MAINE_15032018_SITEIMAGE_01.jpg | 2018-08-13 15:12 | 53K | |
![[IMG]](/icons/image2.gif) | FWFWW_MAINE_15032018_SITEIMAGE_02.jpg | 2018-08-13 15:12 | 36K | |
![[IMG]](/icons/image2.gif) | FWFWW_MAINE_15032018_SITEIMAGE_03.jpg | 2018-08-13 15:12 | 42K | |
![[IMG]](/icons/image2.gif) | FWFWW_MAINE_15032018_SITEIMAGE_04.jpg | 2018-08-13 15:12 | 28K | |
![[IMG]](/icons/image2.gif) | FWFWW_MAINE_15032018_SITEIMAGE_05.jpg | 2018-08-13 15:12 | 53K | |
![[IMG]](/icons/image2.gif) | FWFWW_MOLINA_27042018_SITEIMAGE_01.jpg | 2018-08-13 15:25 | 49K | |
![[IMG]](/icons/image2.gif) | FWFWW_MOLINA_27042018_SITEIMAGE_02.jpg | 2018-08-13 15:25 | 47K | |
![[IMG]](/icons/image2.gif) | FWFWW_MOLINA_27042018_SITEIMAGE_03.jpg | 2018-08-13 15:25 | 36K | |
![[IMG]](/icons/image2.gif) | FWFWW_MOLINA_27042018_SITEIMAGE_04.jpg | 2018-08-13 15:25 | 45K | |
![[IMG]](/icons/image2.gif) | FWFWW_MOLINA_27042018_SITEIMAGE_05.jpg | 2018-08-13 15:25 | 47K | |
![[IMG]](/icons/image2.gif) | FWFWW_Mendi_21082017_SITEIMAGE_B7K3500.jpg | 2018-10-15 13:01 | 120K | |
![[IMG]](/icons/image2.gif) | FWFWW_Mendi_21082017_SITEIMAGE_B7K3627.jpg | 2018-10-15 13:02 | 115K | |
![[IMG]](/icons/image2.gif) | FWFWW_Mendi_21082017_SITEIMAGE_B7K3847.jpg | 2018-10-15 13:03 | 108K | |
![[IMG]](/icons/image2.gif) | FWFWW_Mendi_21082017_SITEIMAGE_B7K3851.jpg | 2018-10-15 13:04 | 121K | |
![[IMG]](/icons/image2.gif) | FWFWW_Mendi_21082017_SITEIMAGE_B7K4019.jpg | 2018-10-15 13:05 | 82K | |
![[IMG]](/icons/image2.gif) | FWFWW_NETLEYPIER_03092015_SITEIMAGE_IMG_9007.jpg | 2018-08-13 15:35 | 63K | |
![[IMG]](/icons/image2.gif) | FWFWW_NETLEYPIER_11112015_SITEIMAGE_Fig_08_Netley_Pier_InSituPilings.jpg | 2018-08-13 15:35 | 62K | |
![[IMG]](/icons/image2.gif) | FWFWW_NETLEYPIER_18052015_SITEIMAGE_DSCF8562.jpg | 2018-08-13 15:35 | 92K | |
![[IMG]](/icons/image2.gif) | FWFWW_NETLEYPIER_18092015_PLAN_Fig_07_Netley_Pier_RTK+AP.jpg | 2018-08-13 15:35 | 55K | |
![[IMG]](/icons/image2.gif) | FWFWW_NETLEYPIER_20062015_SITEIMAGE_DSCF2002.jpg | 2018-08-13 15:35 | 73K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWHAVENSEAPLANE_09082017_SITEIMAGE_DJI_0330.jpg | 2018-08-13 15:44 | 77K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWHAVENSEAPLANE_09082017_SITEIMAGE_IMG_4616.jpg | 2018-08-13 15:44 | 50K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWHAVENSEAPLANE_09082017_SITEIMAGE_IMG_4765.jpg | 2018-08-13 15:44 | 95K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWHAVENSEAPLANE_09082017_SITEIMAGE_IMG_4768.jpg | 2018-08-13 15:44 | 86K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWHAVENSEAPLANE_09082017_SITEIMAGE_IMG_9538.jpg | 2018-08-13 15:44 | 101K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWLYNSEAPLANE_11082016_SITEIMAGE_Photomosaic.jpg | 2018-08-13 15:54 | 221K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWLYNSEAPLANE_13122017_SITEPLAN.jpg | 2018-08-13 15:54 | 32K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWLYNSEAPLANE_24062016_SITEIMAGE_P6240504.jpg | 2018-08-13 15:54 | 92K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWLYNSEAPLANE_24062016_SITEIMAGE_P6240528.jpg | 2018-08-13 15:54 | 102K | |
![[IMG]](/icons/image2.gif) | FWFWW_NEWLYNSEAPLANE_24062016_SITEIMAGE_P6240535.jpg | 2018-08-13 15:54 | 109K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_06042016_SITEIMAGE_DSCF3710.jpg | 2018-08-28 14:14 | 171K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_10082017_SITEIMAGE_IMG_4833.jpg | 2018-08-28 14:14 | 225K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_10082017_SITEIMAGE_IMG_4847.jpg | 2018-08-28 14:14 | 221K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_10082017_SITEIMAGE_IMG_4860.jpg | 2018-08-28 14:14 | 248K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_10082017_SITEIMAGE_IMG_4921.jpg | 2018-08-28 14:14 | 196K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_10082017_SITEIMAGE_IMG_4924.jpg | 2018-08-28 14:14 | 218K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_10082017_SITEIMAGE_IMG_4934.jpg | 2018-08-28 14:14 | 219K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenPort_10082017_SITEIMAGE_IMG_4955.jpg | 2018-08-28 14:14 | 246K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenWireless_06022018_SITEPLAN_Newhaven_wireless_LocationAandB_PLAN.jpg | 2018-08-22 13:22 | 161K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenWireless_07022018_SITEPLAN_Newhaven_wireless_locationA_SITEPLAN.jpg | 2018-08-22 13:22 | 54K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenWireless_07022018_SITEPLAN_Newhaven_wireless_locationB_SITEPLAN.jpg | 2018-08-22 13:22 | 40K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenWireless_10082017_SITEIMAGE_NewhavenWireless_LocationB_IMG_9761.jpg | 2018-08-22 13:23 | 162K | |
![[IMG]](/icons/image2.gif) | FWFWW_NewhavenWireless_10082017_SITEIMAGE_NewhavenWireless_LocationB_IMG_9775.jpg | 2018-08-22 13:22 | 146K | |
![[IMG]](/icons/image2.gif) | FWFWW_Newholm_05072016_SITEIMAGE_MED_3083.jpg | 2018-10-15 13:12 | 137K | |
![[IMG]](/icons/image2.gif) | FWFWW_Newholm_05072016_SITEIMAGE_MED_3212.jpg | 2018-10-15 13:13 | 135K | |
![[IMG]](/icons/image2.gif) | FWFWW_Newholm_05072016_SITEIMAGE_MED_3232.jpg | 2018-10-15 13:14 | 128K | |
![[IMG]](/icons/image2.gif) | FWFWW_Newholm_05072016_SITEIMAGE_MED_3455.jpg | 2018-10-15 13:15 | 182K | |
![[IMG]](/icons/image2.gif) | FWFWW_Newholm_27062016_SITEIMAGE_SANY7609.jpg | 2018-10-15 13:16 | 205K | |
![[IMG]](/icons/image2.gif) | FWFWW_PENZANCEDRYDOCK_23062016_SITEIMAGE_DSCF2498.jpg | 2018-08-13 12:44 | 66K | |
![[IMG]](/icons/image2.gif) | FWFWW_PENZANCEDRYDOCK_23062016_SITEIMAGE_DSCF2518.jpg | 2018-08-13 12:44 | 80K | |
![[IMG]](/icons/image2.gif) | FWFWW_PENZANCEDRYDOCK_23062016_SITEIMAGE_DSCF2541.jpg | 2018-08-13 12:44 | 74K | |
![[IMG]](/icons/image2.gif) | FWFWW_PENZANCEDRYDOCK_23062016_SITEIMAGE_DSCF2543.jpg | 2018-08-13 12:44 | 73K | |
![[IMG]](/icons/image2.gif) | FWFWW_Pandion_14072016_SITEIMAGE_Hull Frame Pandion.jpg | 2018-10-15 13:23 | 114K | |
![[IMG]](/icons/image2.gif) | FWFWW_Pandion_14072016_SITEIMAGE_Pandion Jumbled fittings.jpg | 2018-10-15 13:26 | 90K | |
![[IMG]](/icons/image2.gif) | FWFWW_Pandion_14072016_SITEIMAGE_Pandion conrod mechanism.jpg | 2018-10-15 13:24 | 99K | |
![[IMG]](/icons/image2.gif) | FWFWW_Pandion_14072016_SITEIMAGE_Pandion hull plating and port boiler.jpg | 2018-10-15 13:25 | 103K | |
![[IMG]](/icons/image2.gif) | FWFWW_ParisSteamPinnace_15032018_SITEIMAGE_IMG_7633b.jpg | 2018-10-16 09:17 | 213K | |
![[IMG]](/icons/image2.gif) | FWFWW_ParisSteamPinnace_15032018_SITEIMAGE_IMG_7765b.jpg | 2018-10-16 09:17 | 206K | |
![[IMG]](/icons/image2.gif) | FWFWW_ParisSteamPinnace_15032018_SITEIMAGE_IMG_7824b.jpg | 2018-10-16 09:17 | 260K | |
![[IMG]](/icons/image2.gif) | FWFWW_ParisSteamPinnace_15032018_SITEIMAGE_IMG_8349b.jpg | 2018-10-16 09:18 | 171K | |
![[IMG]](/icons/image2.gif) | FWFWW_PoldhuWireless_08022018_SITEPLAN_extant features.jpg | 2018-08-22 13:27 | 157K | |
![[IMG]](/icons/image2.gif) | FWFWW_PoldhuWireless_27062016_SITEIMAGE_DSCF2646.jpg | 2018-08-22 13:27 | 177K | |
![[IMG]](/icons/image2.gif) | FWFWW_PoldhuWireless_27062016_SITEIMAGE_DSCF2666.jpg | 2018-08-22 13:31 | 172K | |
![[IMG]](/icons/image2.gif) | FWFWW_PoldhuWireless_27062016_SITEIMAGE_DSCF2670.jpg | 2018-08-22 13:31 | 260K | |
![[IMG]](/icons/image2.gif) | FWFWW_PoldhuWireless_27062016_SITEIMAGE_DSCF2672.jpg | 2018-08-22 13:31 | 264K | |
![[IMG]](/icons/image2.gif) | FWFWW_PrawlWireless_13022018_SITEIMAGE_DSCF4559.jpg | 2018-08-22 13:40 | 228K | |
![[IMG]](/icons/image2.gif) | FWFWW_PrawlWireless_13022018_SITEIMAGE_DSCF4568.jpg | 2018-08-22 13:40 | 210K | |
![[IMG]](/icons/image2.gif) | FWFWW_PrawlWireless_30062016_SITEIMAGE_DSCF4551.jpg | 2018-08-22 13:40 | 300K | |
![[IMG]](/icons/image2.gif) | FWFWW_PrawlWireless_30062018_SITEIMAGE_P1010580.jpg | 2018-08-22 13:40 | 140K | |
![[IMG]](/icons/image2.gif) | FWFWW_SANDRINGHAM_24032017_SITEIMAGE_DJI_0030.jpg | 2018-08-13 13:02 | 72K | |
![[IMG]](/icons/image2.gif) | FWFWW_SANDRINGHAM_24032017_SITEIMAGE_DJI_0073.jpg | 2018-08-13 13:02 | 79K | |
![[IMG]](/icons/image2.gif) | FWFWW_SANDRINGHAM_24032017_SITEIMAGE_DJI_0090.jpg | 2018-08-13 13:02 | 76K | |
![[IMG]](/icons/image2.gif) | FWFWW_SANDRINGHAM_24032017_SITEIMAGE_Site plan 2018.jpg | 2018-08-13 13:02 | 42K | |
![[IMG]](/icons/image2.gif) | FWFWW_Serrana_07112017_SITEPLAN_Serrana_Measured_Sketch_2012.jpg | 2018-09-27 17:39 | 37K | |
![[IMG]](/icons/image2.gif) | FWFWW_Serrana_27112014_SITEIMAGE_MP83868_Mike_Pitts.jpg | 2018-09-27 17:41 | 118K | |
![[IMG]](/icons/image2.gif) | FWFWW_Serrana_27112014_SITEIMAGE_MP84163_Mike_Pitts.jpg | 2018-09-27 17:53 | 141K | |
![[IMG]](/icons/image2.gif) | FWFWW_Serrana_29112014_SITEIMAGE_HWT_7884.jpg | 2018-09-27 17:55 | 94K | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010600.jpg | 2018-08-22 13:54 | 293K | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010600.tif | 2018-08-22 13:50 | 1.1M | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010638.jpg | 2018-08-22 13:57 | 299K | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010638.tif | 2018-08-22 13:49 | 1.1M | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010693.jpg | 2018-08-22 13:57 | 301K | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010693.tif | 2018-08-22 13:48 | 1.1M | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010737.jpg | 2018-08-22 13:58 | 328K | |
![[IMG]](/icons/image2.gif) | FWFWW_SixBrothers_01072016_SITEIMAGE_P1010737.tif | 2018-08-22 13:50 | 1.1M | |
![[IMG]](/icons/image2.gif) | FWFWW_SouthWestern_10082018_SITEIMAGE_A7K8545_winch.jpg | 2018-08-22 13:56 | 206K | |
![[IMG]](/icons/image2.gif) | FWFWW_SouthWestern_10082018_SITEIMAGE_B7K4529_boiler with scale.jpg | 2018-08-22 14:04 | 203K | |
![[IMG]](/icons/image2.gif) | FWFWW_SouthWestern_10082018_SITEIMAGE_B7K4706_ engine with rods.jpg | 2018-08-22 14:04 | 192K | |
![[IMG]](/icons/image2.gif) | FWFWW_SouthWestern_10082018_SITEIMAGE_B7K4782_hull collapsed to seabed.jpg | 2018-08-22 14:04 | 187K | |
![[IMG]](/icons/image2.gif) | FWFWW_SouthWestern_10082018_SITEIMAGE_Propeller with stock.jpg | 2018-08-22 14:04 | 167K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig3.jpg | 2018-08-13 13:33 | 84K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig19.jpg | 2018-08-13 13:33 | 68K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig20.jpg | 2018-08-13 13:33 | 80K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig21.jpg | 2018-08-13 13:33 | 80K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig22.jpg | 2018-08-13 13:33 | 84K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig23.jpg | 2018-08-13 13:33 | 73K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig24.jpg | 2018-08-13 13:33 | 70K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig25.jpg | 2018-08-13 13:33 | 85K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig26.jpg | 2018-08-13 13:33 | 82K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig28.jpg | 2018-08-13 13:33 | 46K | |
![[IMG]](/icons/image2.gif) | FWFWW_SultanMastHamble_05052016_Fig29.jpg | 2018-08-13 13:33 | 82K | |
![[IMG]](/icons/image2.gif) | FWFWW_UB-21_13072016_SITEIMAGE_001_Fig5a_MAT_9349.jpg | 2018-08-13 13:49 | 41K | |
![[IMG]](/icons/image2.gif) | FWFWW_UB-21_13072016_SITEIMAGE_014_Fig14_MAT_9307.jpg | 2018-08-13 13:49 | 34K | |
![[IMG]](/icons/image2.gif) | FWFWW_UB-21_29062011_SITEIMAGE_004_Fig7_P6290330.jpg | 2018-08-13 13:49 | 63K | |
![[IMG]](/icons/image2.gif) | FWFWW_UB-21_29062011_SITEIMAGE_005_Fig8_P6290334.jpg | 2018-08-13 13:49 | 66K | |
![[IMG]](/icons/image2.gif) | FWFWW_UB-21_29062011_SITEIMAGE_006_Fig9_P6290328.jpg | 2018-08-13 13:49 | 59K | |
![[IMG]](/icons/image2.gif) | FWFWW_V44_08042016_SITEIMAGE_DJI_0254.jpg | 2018-10-15 13:30 | 180K | |
![[IMG]](/icons/image2.gif) | FWFWW_V44_08042016_SITEIMAGE_DJI_0300.jpg | 2018-10-15 13:31 | 172K | |
![[IMG]](/icons/image2.gif) | FWFWW_V44_08042016_SITEIMAGE_DJI_0367.jpg | 2018-10-15 13:32 | 178K | |
![[IMG]](/icons/image2.gif) | FWFWW_V44_08042016_SITEIMAGE_IMG_6003.jpg | 2018-10-15 13:33 | 130K | |
![[IMG]](/icons/image2.gif) | FWFWW_V82_03062016_SITEIMAGE_P1000386.jpg | 2018-10-16 08:52 | 213K | |
![[IMG]](/icons/image2.gif) | FWFWW_V82_03062016_SITEIMAGE_P1000419.jpg | 2018-10-16 08:52 | 263K | |
![[IMG]](/icons/image2.gif) | FWFWW_V82_03062016_SITEIMAGE_P1000430.jpg | 2018-10-16 08:53 | 145K | |
![[IMG]](/icons/image2.gif) | FWFWW_V82_18052016_SITEIMAGE_V82_Drone.jpg | 2018-10-16 08:53 | 185K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMA0023_2010_002.jpg | 2018-09-27 18:01 | 165K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMA0023_2010_003.jpg | 2018-09-27 18:02 | 139K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMA0023_2010_004.jpg | 2018-09-27 18:00 | 141K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMA0023_2010_006.jpg | 2018-09-27 18:05 | 150K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMS0023_2010_001.jpg | 2018-09-27 18:01 | 175K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMS0023_2010_005.jpg | 2018-09-27 18:10 | 138K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMS0023_2010_008.jpg | 2018-09-27 18:13 | 156K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_29112014_SITEIMAGE_HWTMa0023_2010_007.jpg | 2018-09-27 18:05 | 166K | |
![[IMG]](/icons/image2.gif) | FWFWW_Velox_31082018_SITEPLAN_Velox.jpg | 2018-09-27 18:14 | 59K | |
![[IMG]](/icons/image2.gif) | FWFWW_Venezuela_26042018_SITEIMAGE_Venezuela7-2.jpg | 2018-08-13 14:01 | 33K | |
![[IMG]](/icons/image2.gif) | FWFWW_Venezuela_26042018_SITEIMAGE_Venezuela8-2.jpg | 2018-08-13 14:01 | 40K | |
![[IMG]](/icons/image2.gif) | FWFWW_Venezuela_26042018_SITEIMAGE_Venezuela9-2.jpg | 2018-08-13 14:01 | 42K | |
![[IMG]](/icons/image2.gif) | FWFWW_Venezuela_26042018_SITEIMAGE_Venezuela10-2.jpg | 2018-08-13 14:01 | 39K | |
![[IMG]](/icons/image2.gif) | FWFWW_Venezuela_26042018_SITEIMAGE_Venezuela11-2.jpg | 2018-08-13 14:01 | 57K | |
![[IMG]](/icons/image2.gif) | FWFWW_Venezuela_26042018_SITEIMAGE_Venezuela12-2.jpg | 2018-08-13 14:01 | 71K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESSEX_04052016_SITEIMAGE_IMG_7470.jpg | 2018-08-13 14:10 | 86K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESSEX_04052016_SITEIMAGE_IMG_7495.jpg | 2018-08-13 14:10 | 94K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESSEX_04052016_SITEPLAN_2017 Survey.jpg | 2018-08-13 14:10 | 39K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESSEX_31102017_SITEPLAN_2017 Site plan.jpg | 2018-08-13 14:10 | 44K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESTERNCOAST_03052018_SITEIMAGE_Port side of he ship is breaking down.jpg | 2018-08-13 14:19 | 44K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESTERNCOAST_03052018_SITEIMAGE_Winch near the bow.jpg | 2018-08-13 14:19 | 41K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESTERNCOAST_17072017_SITEIMAGE_Propeller showing propeller boss.jpg | 2018-08-13 14:19 | 94K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESTVILLE_21032018_SITEIMAGE_Westville_Roland Brookes.jpg | 2018-08-13 14:27 | 34K | |
![[IMG]](/icons/image2.gif) | FWFWW_WESTVILLE_21032018_SITEIMAGE_screengrab_fromGoPro1.jpg | 2018-08-13 14:27 | 45K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKNight_08122016_SITEPLAN_War Knight steam turbine drwg_A Williams_.jpg | 2018-09-27 18:38 | 159K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_04112015_3DIMAGE_Capture3Dmodel_engine.jpg | 2018-09-27 18:28 | 100K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_07072015_SITEPLAN_War Knight plan.jpg | 2018-09-27 18:37 | 71K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_29112014_SITEIMAGE_2014-06-24 043 copy_WarKnight_Turbine.jpg | 2018-09-27 18:40 | 243K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_29112014_SITEIMAGE_2014-06-24 048 copy_WarKnight_proptunnel.jpg | 2018-09-27 18:48 | 150K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_29112014_SITEIMAGE_2014-06-24 051 copy_WarKnight_proptunnel.jpg | 2018-09-27 18:49 | 179K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_29112014_SITEIMAGE_2014-06-24 059 copy.jpg | 2018-09-27 18:51 | 106K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_29112014_SITEIMAGE_2014-06-24 063 copy.jpg | 2018-09-27 18:52 | 109K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_29112014_SITEIMAGE_2014-06-24 072_WarKnightTurbine copy.jpg | 2018-09-27 18:53 | 206K | |
![[IMG]](/icons/image2.gif) | FWFWW_WarKnight_29112014_SITEIMAGE_2014-06-24 073 copy.jpg | 2018-09-27 18:54 | 117K | |
![[IMG]](/icons/image2.gif) | FWFWW_Winifred_01072016_SITEIMAGE_P1010788.jpg | 2018-08-22 14:13 | 325K | |
![[IMG]](/icons/image2.gif) | FWFWW_Winifred_27062016_SITEIMAGE_DSCF2692.jpg | 2018-08-22 14:12 | 262K | |
![[IMG]](/icons/image2.gif) | FWFWW_Winifred_27062016_SITEIMAGE_DSCF2696.jpg | 2018-08-22 14:12 | 207K | |
![[IMG]](/icons/image2.gif) | FWFWW_Winifred_27062016_SITEIMAGE_DSCF2715.jpg | 2018-08-22 14:13 | 281K | |
![[IMG]](/icons/image2.gif) | FWFWW_Winifred_27062016_SITEIMAGE_DSCF2716.jpg | 2018-08-22 14:12 | 266K | |
![[IMG]](/icons/image2.gif) | FW_Map_perspective.png | 2021-02-02 18:08 | 2.1M | |
![[IMG]](/icons/image2.gif) | Faber_Service_Card_1.JPG | 2021-01-07 09:47 | 275K | |
![[IMG]](/icons/image2.gif) | Faber_Service_Card_2.JPG | 2020-12-15 14:24 | 115K | |
![[IMG]](/icons/image2.gif) | Facto.png | 2018-07-05 15:57 | 6.1M | |
![[IMG]](/icons/image2.gif) | Fallodon.png | 2018-11-19 13:44 | 5.7M | |
![[IMG]](/icons/image2.gif) | Fanelly Bathymetry 2015.png | 2018-09-06 14:38 | 916K | |
![[IMG]](/icons/image2.gif) | Farn.png | 2018-07-26 14:22 | 3.6M | |
![[IMG]](/icons/image2.gif) | FieryCross.jpg | 2018-10-09 11:36 | 170K | |
![[IMG]](/icons/image2.gif) | Fig3-4_Diver & hawse hole.jpg | 2022-10-31 13:15 | 540K | |
![[IMG]](/icons/image2.gif) | Fig4_Carronade_HWT_6511.JPG | 2022-10-31 11:44 | 903K | |
![[IMG]](/icons/image2.gif) | Fig5_Cannonballs_HWT_6521.JPG | 2022-10-31 11:48 | 1.7M | |
![[IMG]](/icons/image2.gif) | Fig11_UB86UB112FalmouthHotel_MarkMilburn_Pendennis.jpg | 2018-06-06 11:58 | 305K | |
![[IMG]](/icons/image2.gif) | Fig18_MarkMilburn_UB86_SANY8538a.jpg | 2018-06-06 12:04 | 302K | |
![[IMG]](/icons/image2.gif) | Fig22_MarkMilburn_UB112_SANY8512.jpg | 2018-06-06 12:02 | 210K | |
![[IMG]](/icons/image2.gif) | Fig29_MarkMilburn_UB106PressureHull_SANY8749a.jpg | 2018-06-06 12:05 | 290K | |
![[IMG]](/icons/image2.gif) | Fig37_MarkMilburn_UB128Superstructure_SANY8681a.jpg | 2018-06-06 12:07 | 210K | |
![[IMG]](/icons/image2.gif) | Fig45_MarkMilburn_UB97Frame.jpg | 2018-06-06 12:08 | 106K | |
![[IMG]](/icons/image2.gif) | Fig46_MarkMilburn_UB97_BowFrame_SANY8601a.jpg | 2018-06-06 12:21 | 237K | |
![[IMG]](/icons/image2.gif) | Fig_1-9_Diver_AB1_2010_IMG_2719.JPG | 2022-10-27 11:36 | 524K | |
![[IMG]](/icons/image2.gif) | Fig_2-6_AnchorOnAB1[Roland Brooks].jpg | 2022-10-29 09:41 | 2.8M | |
![[IMG]](/icons/image2.gif) | Fig_2-6_Inset_AnchorDamageOnAB1[Roland Brooks].jpg | 2022-10-27 10:20 | 665K | |
![[IMG]](/icons/image2.gif) | Fig_2-12_Bottom_HawseHoles-2013.jpg | 2022-10-27 10:39 | 665K | |
![[IMG]](/icons/image2.gif) | Fig_2-12_Middle_HawseHole-2001.jpg | 2022-10-26 12:35 | 806K | |
![[IMG]](/icons/image2.gif) | Fig_2-12_Top_HawseHoles-1993.jpg | 2022-10-27 10:35 | 696K | |
![[IMG]](/icons/image2.gif) | Fig_2-13_Bottom_AB2Frames-2013[RolandBrooks].jpg | 2022-10-29 09:17 | 3.3M | |
![[IMG]](/icons/image2.gif) | Fig_2-13_Middle_AB2Frames-2003.jpg | 2022-10-29 09:19 | 1.4M | |
![[IMG]](/icons/image2.gif) | Fig_2-13_Top_AB2Frames-2003.jpg | 2022-10-26 15:34 | 2.1M | |
![[IMG]](/icons/image2.gif) | Fig_3-2_DiverRecording[AB93_A-016].jpg | 2022-10-27 11:23 | 1.0M | |
![[IMG]](/icons/image2.gif) | Fig_3-3_AB1_SitePlan_1991-1999.png | 2022-10-26 13:06 | 786K | |
![[IMG]](/icons/image2.gif) | Fig_3-4_AB1_RecordingFrame_AB00_A-009.jpg | 2022-10-27 11:53 | 1.8M | |
![[IMG]](/icons/image2.gif) | Fig_3-5_AB1_SitePlan_2000-2002.jpg | 2022-10-26 13:41 | 366K | |
![[IMG]](/icons/image2.gif) | Fig_3-6_AB1_SitePlan_2010.png | 2022-10-26 14:14 | 1.4M | |
![[IMG]](/icons/image2.gif) | Fig_3-8_AB1_Interpretative_SitePlan@1to20.png | 2022-10-27 11:59 | 430K | |
![[IMG]](/icons/image2.gif) | Fig_3-11_AB1_Framing2010.JPG | 2022-10-29 09:35 | 5.2M | |
![[IMG]](/icons/image2.gif) | Fig_3-12_AB1_HawseHoles[RolandBrooks].jpg | 2022-10-26 15:22 | 846K | |
![[IMG]](/icons/image2.gif) | Fig_3-16_AB1_HawseHoleFastenings[Mike_Pitts].jpg | 2022-10-29 09:30 | 698K | |
![[IMG]](/icons/image2.gif) | Fig_3-18_AB1_Pomone_CopperSheathing@1to1[Dave_Selmo].jpg | 2022-10-29 09:30 | 2.1M | |
![[IMG]](/icons/image2.gif) | Fig_4-3_AB2_2002_[DiverPlanning_x2_HWTMA].jpg | 2022-10-27 15:53 | 1.1M | |
![[IMG]](/icons/image2.gif) | Fig_4-4_AB2_Monitoring2013[Rowland Brooks].jpg | 2022-10-27 15:49 | 941K | |
![[IMG]](/icons/image2.gif) | Fig_4-5_AB2_SitePlan_2012[HWTMA].png | 2022-10-27 16:00 | 442K | |
![[IMG]](/icons/image2.gif) | Fig_4-7_AB2_Frames&PlankingOnSouthernSide[HWTMA].JPG | 2022-10-29 09:33 | 2.5M | |
![[IMG]](/icons/image2.gif) | Fig_5-5_CarriageTruck[HWTMA].jpg | 2022-10-26 16:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | Fig_6-4_DiveTrail_Layout.jpg | 2022-10-27 16:10 | 468K | |
![[IMG]](/icons/image2.gif) | Figure1_JohnMitchell_PoLRSCredit.jpg | 2018-06-04 13:10 | 112K | |
![[IMG]](/icons/image2.gif) | Figure 5 Needles Drift 01062012 (1).jpg | 2022-10-31 12:31 | 252K | |
![[IMG]](/icons/image2.gif) | Find a grave larger image.jpg | 2020-12-15 17:04 | 4.9M | |
![[IMG]](/icons/image2.gif) | Fish Storage Bulkhead.jpg | 2024-09-05 10:12 | 2.2M | |
![[IMG]](/icons/image2.gif) | Fold3_Page_1_Selective_Service_Registration_Cards_World_War_II_Multiple_Registrations (1).jpg | 2020-12-14 18:00 | 327K | |
![[IMG]](/icons/image2.gif) | Fold3_Page_1_Selective_Service_Registration_Cards_World_War_II_Multiple_Registrations (3).jpg | 2021-02-03 08:54 | 279K | |
![[IMG]](/icons/image2.gif) | Fold3_Page_1_Selective_Service_Registration_Cards_World_War_II_Multiple_Registrations (8).jpg | 2021-03-11 11:49 | 418K | |
![[IMG]](/icons/image2.gif) | Fold3_Page_1_Selective_Service_Registration_Cards_World_War_II_Multiple_Registrations.jpg | 2020-12-16 12:58 | 411K | |
![[IMG]](/icons/image2.gif) | Fold3_Page_2_Selective_Service_Registration_Cards_World_War_II_Multiple_Registrations (3).jpg | 2021-02-03 08:55 | 252K | |
![[IMG]](/icons/image2.gif) | Fold3_Page_2_Selective_Service_Registration_Cards_World_War_II_Multiple_Registrations (6).jpg | 2021-03-11 11:49 | 387K | |
![[IMG]](/icons/image2.gif) | Fold3_Page_2_Selective_Service_Registration_Cards_World_War_II_Multiple_Registrations.jpg | 2020-12-14 18:02 | 330K | |
![[IMG]](/icons/image2.gif) | Fold3_Registration_Cards_Recine_1.jpg | 2021-01-08 18:00 | 496K | |
![[IMG]](/icons/image2.gif) | Fold3_Registration_Cards_Recine_2.jpg | 2021-01-08 18:00 | 403K | |
![[IMG]](/icons/image2.gif) | ForDB_Fig40_COLLINS.202B_Falmouth_Uboats_UB128_UB97_UB86_UB112.jpg | 2018-06-06 11:49 | 113K | |
![[IMG]](/icons/image2.gif) | ForDB_Fig41_COLLINS.202C_Falmouth_Uboats_UB128_UB97_UB112.jpg | 2018-06-06 11:55 | 121K | |
![[IMG]](/icons/image2.gif) | ForDB_Fig42_COLLINS.202D_Falmouth_Uboats_UB97.jpg | 2018-06-06 11:51 | 127K | |
![[IMG]](/icons/image2.gif) | Formidable letter1.jpg | 2023-11-20 13:00 | 360K | |
![[IMG]](/icons/image2.gif) | Formidable letter2.jpg | 2023-11-20 13:03 | 451K | |
![[IMG]](/icons/image2.gif) | Fortuna Bathymetry 2015.png | 2018-10-04 14:22 | 744K | |
![[IMG]](/icons/image2.gif) | Foyle_Rudder_DRobinson.jpg | 2019-05-02 09:51 | 114K | |
![[IMG]](/icons/image2.gif) | Foylemore.png | 2018-07-12 14:35 | 1.4M | |
![[IMG]](/icons/image2.gif) | Frank_Irr_Draft Card pg 1.jpg | 2021-01-05 12:51 | 233K | |
![[IMG]](/icons/image2.gif) | Frank_Irr_Draft Card pg 2.jpg | 2021-01-05 12:52 | 210K | |
![[IMG]](/icons/image2.gif) | Fred Clark Draft Card pg 1.jpg | 2020-12-15 16:04 | 255K | |
![[IMG]](/icons/image2.gif) | Fred Clark Draft Card pg 2.jpg | 2020-12-15 16:05 | 122K | |
![[IMG]](/icons/image2.gif) | Friel Seated.jpg | 2020-12-15 17:27 | 758K | |
![[IMG]](/icons/image2.gif) | Friel back of photo.jpg | 2020-12-15 17:26 | 595K | |
![[IMG]](/icons/image2.gif) | Friel head and shoulders.JPG | 2020-12-15 17:25 | 29K | |
![[IMG]](/icons/image2.gif) | Friel standinf.jpg | 2020-12-15 17:28 | 646K | |
![[IMG]](/icons/image2.gif) | Frons Olive Bathymetry 2014.png | 2018-09-18 13:11 | 1.3M | |
![[IMG]](/icons/image2.gif) | GEO FABER COLO BRICK.jpg | 2021-01-07 09:50 | 901K | |
![[IMG]](/icons/image2.gif) | GNBunker.png | 2019-09-12 15:19 | 43K | |
![[IMG]](/icons/image2.gif) | GNBunker_inscrip.jpg | 2020-12-22 10:05 | 56K | |
![[IMG]](/icons/image2.gif) | GNBunker_inscrip.png | 2020-12-22 09:59 | 21K | |
![[IMG]](/icons/image2.gif) | GN_Bunker_Inscription_2019.jpg | 2019-06-01 17:44 | 220K | |
![[IMG]](/icons/image2.gif) | Galicia Bathymetry 2015.png | 2018-10-04 15:07 | 1.0M | |
![[IMG]](/icons/image2.gif) | Gallia_SSS_NavitusBay.jpg | 2018-10-10 10:18 | 767K | |
![[IMG]](/icons/image2.gif) | Garm.png | 2018-07-26 14:26 | 3.7M | |
![[IMG]](/icons/image2.gif) | Gefion Bathymetry 2015.png | 2018-10-04 15:11 | 907K | |
![[IMG]](/icons/image2.gif) | General Leman.png | 2018-07-26 14:29 | 5.3M | |
![[IMG]](/icons/image2.gif) | Geof_Faber_Inscription_2019.jpg | 2019-05-29 17:32 | 173K | |
![[IMG]](/icons/image2.gif) | Geof_Faber_Inscription_2019.png | 2021-01-07 09:51 | 34K | |
![[IMG]](/icons/image2.gif) | Geof_Faber_inscription_2019.jpg | 2019-06-01 17:30 | 919K | |
![[IMG]](/icons/image2.gif) | George Faber from Capital University, Ohio Yearbook 1947.JPG | 2021-01-07 09:53 | 64K | |
![[IMG]](/icons/image2.gif) | Ghurka Bathymetry 2015.png | 2018-08-31 15:14 | 595K | |
![[IMG]](/icons/image2.gif) | Gibel Hamam Bathymetry 2015.png | 2018-10-04 15:14 | 1.1M | |
![[IMG]](/icons/image2.gif) | Glenarm Head.png | 2018-11-19 13:18 | 150K | |
![[IMG]](/icons/image2.gif) | Glenn_N_Bunker_in_uniform.jpg | 2019-05-29 12:18 | 44K | |
![[IMG]](/icons/image2.gif) | Glocliffe.png | 2018-07-26 14:32 | 3.2M | |
![[IMG]](/icons/image2.gif) | Golden draft card pg 1.jpg | 2021-01-07 10:02 | 233K | |
![[IMG]](/icons/image2.gif) | Golden draft card pg 2.jpg | 2021-01-07 10:03 | 217K | |
![[IMG]](/icons/image2.gif) | GosportSteamPinnace FL7.jpg | 2018-10-09 11:40 | 138K | |
![[IMG]](/icons/image2.gif) | Graffiti and inscription tracing.JPG | 2020-12-16 12:47 | 69K | |
![[IMG]](/icons/image2.gif) | Grave.jpg | 2020-12-15 16:22 | 2.6M | |
![[IMG]](/icons/image2.gif) | Grave from 99th group FB.jpg | 2020-12-16 10:07 | 291K | |
![[IMG]](/icons/image2.gif) | Great_Uncle_Tom_03.jpg | 2019-11-06 14:48 | 226K | |
![[IMG]](/icons/image2.gif) | Greatham.png | 2018-07-26 14:36 | 3.5M | |
![[IMG]](/icons/image2.gif) | Greenwald_Draft Card pg 1.jpg | 2021-01-05 12:30 | 226K | |
![[IMG]](/icons/image2.gif) | Greenwald_Draft Card pg 2.jpg | 2021-01-05 12:31 | 226K | |
![[IMG]](/icons/image2.gif) | Greenwald_MuseumCol_2019.jpg | 2019-05-29 17:35 | 228K | |
![[IMG]](/icons/image2.gif) | Greenwald_Soton_Museum_2019.jpg | 2019-06-01 17:33 | 258K | |
![[IMG]](/icons/image2.gif) | Greleen Bathymetry 2015.png | 2018-10-04 15:17 | 1.6M | |
![[IMG]](/icons/image2.gif) | Grelhame.png | 2018-07-12 14:39 | 435K | |
![[IMG]](/icons/image2.gif) | Groth_Newspaper_1973.jpg | 2019-06-01 17:25 | 310K | |
![[IMG]](/icons/image2.gif) | HEATHERINGTON_Inscription_2019.jpg | 2019-05-29 17:43 | 322K | |
![[IMG]](/icons/image2.gif) | HHeatherington.png | 2020-12-16 10:24 | 69K | |
![[IMG]](/icons/image2.gif) | HMHS Anglia & HMS Ure.jpg | 2018-10-09 12:00 | 179K | |
![[IMG]](/icons/image2.gif) | HMHS Asturias 300dpi.jpg | 2018-10-09 11:44 | 104K | |
![[IMG]](/icons/image2.gif) | HMS Formidable.jpg | 2018-10-09 11:45 | 153K | |
![[IMG]](/icons/image2.gif) | HMS Nubian 600dpi.jpg | 2018-10-09 11:48 | 160K | |
![[IMG]](/icons/image2.gif) | HMS_Foyle_Gun_DRobinson.jpg | 2019-05-02 09:51 | 98K | |
![[IMG]](/icons/image2.gif) | Halfdan.png | 2018-07-12 14:42 | 497K | |
![[IMG]](/icons/image2.gif) | Harpalion Bathymetry 2015.png | 2018-09-06 14:42 | 861K | |
![[IMG]](/icons/image2.gif) | Harry_Cicero_Illinois_Inscription_2019.jpg | 2019-05-29 17:37 | 724K | |
![[IMG]](/icons/image2.gif) | Harry_Cicero_Inscription_2019.jpg | 2019-06-01 17:31 | 693K | |
![[IMG]](/icons/image2.gif) | Hartburn.png | 2018-11-19 13:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | Harvey_brick_B&W.jpg | 2020-12-15 14:05 | 445K | |
![[IMG]](/icons/image2.gif) | Hatchway.jpg | 2024-09-05 10:12 | 1.9M | |
![[IMG]](/icons/image2.gif) | Havbris.png | 2018-07-12 14:46 | 333K | |
![[IMG]](/icons/image2.gif) | Hazard Bathymetry 2013.png | 2018-10-04 15:54 | 1.0M | |
![[IMG]](/icons/image2.gif) | Head crop.jpg | 2019-12-18 14:55 | 45K | |
![[IMG]](/icons/image2.gif) | Heatherington_Application_for_headstone.JPG | 2020-12-15 17:36 | 235K | |
![[IMG]](/icons/image2.gif) | Heatherington_Service_Reg_Card_1.JPG | 2020-12-15 17:38 | 254K | |
![[IMG]](/icons/image2.gif) | Heatherington_Service_Reg_Card_2.JPG | 2020-12-15 17:38 | 105K | |
![[IMG]](/icons/image2.gif) | Heatherington_Zion_inscription_2019.jpg | 2019-06-01 17:30 | 661K | |
![[IMG]](/icons/image2.gif) | Heatherington headstone.jpg | 2020-12-15 17:39 | 1.3M | |
![[IMG]](/icons/image2.gif) | Helmling Photo.jpeg | 2019-12-18 14:39 | 363K | |
![[IMG]](/icons/image2.gif) | Helmling_Draft Card Pg 1.jpg | 2021-01-05 12:49 | 259K | |
![[IMG]](/icons/image2.gif) | Helmling_Draft Card Pg 2.jpg | 2021-01-05 12:49 | 247K | |
![[IMG]](/icons/image2.gif) | HerringFinder Bathymetry 2015.png | 2018-09-06 14:44 | 904K | |
![[IMG]](/icons/image2.gif) | Hewitt_Callaway_Inscription_2019.jpg | 2019-05-29 17:45 | 466K | |
![[IMG]](/icons/image2.gif) | Highland Brigade.png | 2018-11-19 13:44 | 5.7M | |
![[IMG]](/icons/image2.gif) | Hildebrandt_The_Needles.jpg | 2023-01-23 12:15 | 240K | |
![[IMG]](/icons/image2.gif) | Historic Image quartermasters sign_Lawrence.jpg | 2021-01-07 18:13 | 155K | |
![[IMG]](/icons/image2.gif) | Historic Image quartermasters sign_Smith.jpg | 2021-01-08 18:19 | 155K | |
![[IMG]](/icons/image2.gif) | Historic Image quartermasters sign_henley.jpg | 2021-01-07 10:31 | 155K | |
![[IMG]](/icons/image2.gif) | Hockwold.png | 2018-07-12 14:49 | 5.8M | |
![[IMG]](/icons/image2.gif) | Holland Bathymetry 1916.png | 2018-09-06 15:37 | 738K | |
![[IMG]](/icons/image2.gif) | Hollybrook overiew small.jpg | 2018-10-18 21:16 | 538K | |
![[IMG]](/icons/image2.gif) | Horsea Island.jpg | 2018-10-09 11:49 | 138K | |
![[IMG]](/icons/image2.gif) | IMG_0354_ed.jpg | 2018-07-31 13:24 | 4.2M | |
![[IMG]](/icons/image2.gif) | IMG_0752 Feb 45 Museum brick see HER 1993 goes with Wempen inscription separated.JPG | 2020-12-16 15:46 | 5.0M | |
![[IMG]](/icons/image2.gif) | IMG_8396 CURT HODGES edited.jpg | 2020-12-16 09:25 | 4.2M | |
![[IMG]](/icons/image2.gif) | IMG_8764 James Dodd.jpg | 2020-12-15 17:02 | 949K | |
![[IMG]](/icons/image2.gif) | IMG_8794 small wall clear photo.jpg | 2020-12-14 18:16 | 142K | |
![[IMG]](/icons/image2.gif) | IMG_20181205_104601369 CJ Moore Wisconsin.jpg | 2019-12-18 14:53 | 1.4M | |
![[IMG]](/icons/image2.gif) | IMG_20200306_120911 KEN COLBY MASS.jpg | 2020-12-15 16:20 | 5.6M | |
![[IMG]](/icons/image2.gif) | IMG_20200306_121446 Delbert Smith whole group.jpg | 2020-12-16 12:56 | 7.2M | |
![[IMG]](/icons/image2.gif) | IMG_20200306_121546 FPO CLARK LOUISEVILLE KY edited.jpg | 2020-12-15 16:15 | 7.7M | |
![[IMG]](/icons/image2.gif) | IMG_20200620_151231.jpg | 2020-12-14 17:41 | 3.4M | |
![[IMG]](/icons/image2.gif) | IMG_20200620_151457 Meyer.jpg | 2020-12-16 11:38 | 3.5M | |
![[IMG]](/icons/image2.gif) | IMG_20200620_152804 IRR.jpg | 2020-12-16 10:06 | 2.7M | |
![[IMG]](/icons/image2.gif) | IMG_20200620_152925 MUELLER.jpg | 2020-12-16 12:22 | 3.9M | |
![[IMG]](/icons/image2.gif) | IMG_20200620_153021 LAURENCE MATHIS.jpg | 2020-12-16 11:30 | 3.2M | |
![[IMG]](/icons/image2.gif) | IMG_20200620_155129 WOODROW MORRIS M AUGUSTA GEORGIA.jpg | 2020-12-16 11:51 | 3.6M | |
![[IMG]](/icons/image2.gif) | IMG_20210125_140941.jpg | 2021-02-11 10:52 | 10M | |
![[IMG]](/icons/image2.gif) | IMG_20210125_140941 2021.jpg | 2021-02-11 10:55 | 1.0M | |
![[IMG]](/icons/image2.gif) | IWM A24011 USS LST262 at SOTON 10 JUNE 1944.jpg | 2021-01-07 18:26 | 60K | |
![[IMG]](/icons/image2.gif) | Iiston Bathymetry 2014.png | 2018-09-03 10:59 | 827K | |
![[IMG]](/icons/image2.gif) | Ikeda.png | 2018-11-19 13:45 | 197K | |
![[IMG]](/icons/image2.gif) | Ikeda bathymetry 2015.png | 2018-10-04 14:26 | 970K | |
![[IMG]](/icons/image2.gif) | Ilaro Bathymetry 2010.png | 2018-09-03 10:25 | 1.3M | |
![[IMG]](/icons/image2.gif) | Indutiomare.png | 2018-10-10 10:14 | 561K | |
![[IMG]](/icons/image2.gif) | Ino Bathymetry 2017.png | 2018-10-08 10:19 | 763K | |
![[IMG]](/icons/image2.gif) | Inside the Upturned Hull (2).jpg | 2024-09-05 10:12 | 1.6M | |
![[IMG]](/icons/image2.gif) | Irene bathymetry 2017.png | 2018-10-08 10:22 | 686K | |
![[IMG]](/icons/image2.gif) | Ironwork-2013[Roland_Brooks].jpg | 2022-10-26 15:51 | 649K | |
![[IMG]](/icons/image2.gif) | Isleworth.png | 2018-04-26 15:28 | 4.9M | |
![[IMG]](/icons/image2.gif) | JCKelley_inscription.png | 2021-01-07 17:47 | 27K | |
![[IMG]](/icons/image2.gif) | JOE_HAMMOND_Inscription_2019.jpg | 2019-05-29 17:49 | 265K | |
![[IMG]](/icons/image2.gif) | JW Metz Draft Card Page 1.jpg | 2021-01-07 18:41 | 417K | |
![[IMG]](/icons/image2.gif) | JW Metz Draft Card Page 2.jpg | 2021-01-07 18:41 | 450K | |
![[IMG]](/icons/image2.gif) | J_Johnston_Draft Card pg 1.jpg | 2021-01-07 18:02 | 386K | |
![[IMG]](/icons/image2.gif) | J_Johnston_Draft Card pg 2.jpg | 2021-01-07 18:03 | 315K | |
![[IMG]](/icons/image2.gif) | James E Vaughn Chattanooga Draft Card Pg 1.jpg | 2021-01-08 18:29 | 250K | |
![[IMG]](/icons/image2.gif) | James E Vaughn Chattanooga Draft Card Pg 2.jpg | 2021-01-08 18:29 | 216K | |
![[IMG]](/icons/image2.gif) | James Edward WORDS Draft Card side 1.jpg | 2021-01-08 18:38 | 547K | |
![[IMG]](/icons/image2.gif) | James Edward WORDS Draft Card side 2.jpg | 2021-01-08 18:39 | 548K | |
![[IMG]](/icons/image2.gif) | James Henley Draft Card.jpg | 2020-12-15 17:59 | 445K | |
![[IMG]](/icons/image2.gif) | James Henley Draft Card pg 2.jpg | 2020-12-15 17:59 | 404K | |
![[IMG]](/icons/image2.gif) | James Leo Friel Draft Card Side 1.jpg | 2020-12-15 17:29 | 387K | |
![[IMG]](/icons/image2.gif) | James Leo Friel Draft Card Side 2.jpg | 2020-12-15 17:29 | 413K | |
![[IMG]](/icons/image2.gif) | James Metz Photo 1974 from Ancestry public tree.jpg | 2021-01-07 18:44 | 23K | |
![[IMG]](/icons/image2.gif) | James Vaughn grave.jpeg | 2021-01-08 18:30 | 274K | |
![[IMG]](/icons/image2.gif) | James_Dodd_Draft Card pg 1.jpg | 2021-01-05 11:10 | 221K | |
![[IMG]](/icons/image2.gif) | James_Dodd_Draft Card pg 2.jpg | 2021-01-05 11:10 | 187K | |
![[IMG]](/icons/image2.gif) | James_Dodd_Veteran Compensation.jpg | 2021-01-05 12:28 | 1.0M | |
![[IMG]](/icons/image2.gif) | James_Dodd_Veteran Compensation pg 2.jpg | 2021-01-05 12:29 | 772K | |
![[IMG]](/icons/image2.gif) | Jefferson_Lawrence_Draft card pg1.jpg | 2021-01-07 18:10 | 298K | |
![[IMG]](/icons/image2.gif) | Jefferson_Lawrence_Draft card pg2.jpg | 2021-01-07 18:11 | 251K | |
![[IMG]](/icons/image2.gif) | Jewett_Callaway Draft_Card_1.jpg | 2021-01-05 12:53 | 327K | |
![[IMG]](/icons/image2.gif) | Jewett_Callaway_Draft_Card_2.jpg | 2021-01-05 12:53 | 330K | |
![[IMG]](/icons/image2.gif) | JoeHammond.png | 2019-09-12 15:26 | 29K | |
![[IMG]](/icons/image2.gif) | JoeHammond_inscrip.png | 2020-12-22 09:36 | 23K | |
![[IMG]](/icons/image2.gif) | Joe N Jones.png | 2019-09-12 15:24 | 28K | |
![[IMG]](/icons/image2.gif) | Joe N Jones_W.png | 2021-01-07 17:56 | 32K | |
![[IMG]](/icons/image2.gif) | Joe N Jones_solid.png | 2020-12-22 09:26 | 22K | |
![[IMG]](/icons/image2.gif) | Joe_N_Jones_Inscription_2019.JPG | 2019-05-29 18:26 | 295K | |
![[IMG]](/icons/image2.gif) | Joe_N_Jones_Inscription_2019.jpg | 2019-06-01 17:27 | 459K | |
![[IMG]](/icons/image2.gif) | John Richard Millett.jpg | 2023-11-09 11:54 | 34K | |
![[IMG]](/icons/image2.gif) | John_Helmling_Inscription_2019.jpg | 2019-05-29 18:30 | 508K | |
![[IMG]](/icons/image2.gif) | John melming.jpg | 2019-07-24 14:13 | 713K | |
![[IMG]](/icons/image2.gif) | John melming.png | 2020-12-16 10:32 | 163K | |
![[IMG]](/icons/image2.gif) | Johnny Johnson_inscription.png | 2021-01-07 18:07 | 79K | |
![[IMG]](/icons/image2.gif) | Juno.png | 2019-03-13 10:55 | 1.5M | |
![[IMG]](/icons/image2.gif) | Jupiter.png | 2018-11-19 13:58 | 432K | |
![[IMG]](/icons/image2.gif) | KEN_LIL_BY_Inscription_2019.jpg | 2019-05-29 18:33 | 355K | |
![[IMG]](/icons/image2.gif) | Kelley Draft Card pg 1.jpg | 2021-01-07 17:42 | 266K | |
![[IMG]](/icons/image2.gif) | Kelley Draft Card pg 2.jpg | 2021-01-07 17:43 | 208K | |
![[IMG]](/icons/image2.gif) | Kelley Grave.jpg | 2021-01-07 17:44 | 237K | |
![[IMG]](/icons/image2.gif) | Kelley_Brick_Inscription_crop.jpg | 2021-01-07 17:52 | 79K | |
![[IMG]](/icons/image2.gif) | Ken Colby Draft Card pg 2.jpg | 2021-01-05 10:58 | 326K | |
![[IMG]](/icons/image2.gif) | Ken Colby Mass.png | 2020-12-16 10:16 | 75K | |
![[IMG]](/icons/image2.gif) | Ken Colby_Draft Card pg 1.jpg | 2021-01-05 10:58 | 386K | |
![[IMG]](/icons/image2.gif) | KendallCastle.png | 2018-07-26 14:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | Kevin Finneran Draft Card.jpg | 2021-01-07 09:58 | 363K | |
![[IMG]](/icons/image2.gif) | Kevin Finneran Draft Card Side 2.jpg | 2021-01-07 09:58 | 325K | |
![[IMG]](/icons/image2.gif) | Kinross_possible.png | 2018-07-12 14:56 | 1.5M | |
![[IMG]](/icons/image2.gif) | Kurland.png | 2018-11-19 13:45 | 5.3M | |
![[IMG]](/icons/image2.gif) | LST 262 Passenger List.JPG | 2020-12-16 18:04 | 168K | |
![[IMG]](/icons/image2.gif) | LST list_Jones.JPG | 2021-01-07 17:58 | 112K | |
![[IMG]](/icons/image2.gif) | La Negra.png | 2018-07-12 14:59 | 6.0M | |
![[IMG]](/icons/image2.gif) | La Somme Bathymetry 2015.png | 2018-08-31 15:16 | 537K | |
![[IMG]](/icons/image2.gif) | Laertes.png | 2018-07-12 15:03 | 448K | |
![[IMG]](/icons/image2.gif) | Laforey.png | 2018-11-19 13:45 | 262K | |
![[IMG]](/icons/image2.gif) | Lancer II Bathymetry 2015.png | 2018-10-04 14:29 | 706K | |
![[IMG]](/icons/image2.gif) | Lawrence Mathis 1987.JPG | 2020-12-16 11:31 | 46K | |
![[IMG]](/icons/image2.gif) | Leicester.png | 2018-07-26 15:35 | 1.7M | |
![[IMG]](/icons/image2.gif) | Leon.png | 2018-11-19 13:46 | 5.4M | |
![[IMG]](/icons/image2.gif) | Lockwood.png | 2018-07-12 15:08 | 650K | |
![[IMG]](/icons/image2.gif) | Lofoten.png | 2018-07-26 14:44 | 1.3M | |
![[IMG]](/icons/image2.gif) | Lord Stewart Bathymetry 2015.png | 2018-10-04 15:20 | 908K | |
![[IMG]](/icons/image2.gif) | Luddy Draft Card pg 1.jpg | 2021-01-07 18:22 | 227K | |
![[IMG]](/icons/image2.gif) | Luddy Draft Card pg 2.jpg | 2021-01-07 18:22 | 184K | |
![[IMG]](/icons/image2.gif) | Luddy address in Webbs file.JPG | 2021-01-07 18:23 | 33K | |
![[IMG]](/icons/image2.gif) | Lusitania.png | 2018-07-26 15:39 | 2.1M | |
![[IMG]](/icons/image2.gif) | Lydie Bathymetry 2014.png | 2018-09-03 10:42 | 814K | |
![[IMG]](/icons/image2.gif) | M J Wempen brick HER more detail.JPG | 2020-12-16 15:45 | 56K | |
![[IMG]](/icons/image2.gif) | MODONALD brick 1.jpg | 2021-01-07 18:36 | 286K | |
![[IMG]](/icons/image2.gif) | MP_CARTER_Inscription_2019.jpg | 2019-05-29 18:34 | 166K | |
![[IMG]](/icons/image2.gif) | Maloja.jpg | 2018-10-09 12:02 | 108K | |
![[IMG]](/icons/image2.gif) | Maloja.png | 2018-11-19 13:47 | 1.8M | |
![[IMG]](/icons/image2.gif) | Malta Bathymetry 2009.png | 2018-10-08 12:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | Marguerite Bathymetry 2015.png | 2018-10-04 15:23 | 895K | |
![[IMG]](/icons/image2.gif) | Martha Bathymetry 2015.png | 2018-10-04 15:26 | 1.1M | |
![[IMG]](/icons/image2.gif) | Mason_Grave.jpg | 2021-01-07 18:32 | 363K | |
![[IMG]](/icons/image2.gif) | Mason draft card pg 1.jpg | 2021-01-07 18:31 | 244K | |
![[IMG]](/icons/image2.gif) | Mason draft card pg 2.jpg | 2021-01-07 18:32 | 232K | |
![[IMG]](/icons/image2.gif) | Mathis_Draft Card Side 1.jpg | 2021-01-05 12:55 | 277K | |
![[IMG]](/icons/image2.gif) | Mathis_Draft Card Side 2.jpg | 2021-01-05 12:55 | 318K | |
![[IMG]](/icons/image2.gif) | Matildais3.jpg | 2020-12-14 13:09 | 1.9M | |
![[IMG]](/icons/image2.gif) | Maurice James Wempen Photo from family.JPG | 2019-12-19 09:57 | 92K | |
![[IMG]](/icons/image2.gif) | McDonald Grave.jpg | 2021-01-07 18:38 | 52K | |
![[IMG]](/icons/image2.gif) | McDonald brick 2 SAM ST LOUIS.JPG | 2021-01-07 18:37 | 170K | |
![[IMG]](/icons/image2.gif) | Medina.png | 2018-04-26 15:49 | 8.0M | |
![[IMG]](/icons/image2.gif) | Memorial to the crew of Scrappy Mike at St Clair de Halouze, France.jpg | 2021-02-03 08:56 | 193K | |
![[IMG]](/icons/image2.gif) | Menapier Bathymetry 2017.png | 2018-10-08 10:27 | 843K | |
![[IMG]](/icons/image2.gif) | Mendi.jpg | 2018-10-09 11:52 | 151K | |
![[IMG]](/icons/image2.gif) | Mervyn.png | 2018-07-12 15:12 | 5.7M | |
![[IMG]](/icons/image2.gif) | Milo.png | 2018-11-19 13:47 | 556K | |
![[IMG]](/icons/image2.gif) | Minerva Bathymetry 2015.png | 2018-10-04 15:29 | 1.6M | |
![[IMG]](/icons/image2.gif) | Miniota Bathymetry 2015.png | 2018-10-09 10:30 | 3.0M | |
![[IMG]](/icons/image2.gif) | Mira Bathymetry 2015.png | 2018-09-06 14:47 | 1.8M | |
![[IMG]](/icons/image2.gif) | Moidart Bathymetry 2015.png | 2018-10-04 15:31 | 1.0M | |
![[IMG]](/icons/image2.gif) | Moldavia_McDonagh2018_IMG_8893.jpg | 2018-06-12 13:01 | 818K | |
![[IMG]](/icons/image2.gif) | Moldavia_McDonagh2018_IMG_8903.jpg | 2018-06-12 13:01 | 738K | |
![[IMG]](/icons/image2.gif) | Moldavia_McDonagh2018_IMG_8915.jpg | 2018-06-12 13:02 | 942K | |
![[IMG]](/icons/image2.gif) | Moldavia_McDonagh2018_IMG_8917.jpg | 2018-06-12 13:03 | 677K | |
![[IMG]](/icons/image2.gif) | Moldavia_McDonagh2018_IMG_8934.jpg | 2018-06-12 13:04 | 848K | |
![[IMG]](/icons/image2.gif) | Moldavia_McDonagh2018_IMG_8945.jpg | 2018-06-12 13:05 | 690K | |
![[IMG]](/icons/image2.gif) | Monarch Bathymetry 2016.png | 2018-09-06 15:17 | 729K | |
![[IMG]](/icons/image2.gif) | Montrose Bathymetry 2009.png | 2018-10-08 12:10 | 1.5M | |
![[IMG]](/icons/image2.gif) | Moore Draft card pg1.jpg | 2021-01-07 18:47 | 194K | |
![[IMG]](/icons/image2.gif) | Moore Draft card pg2.jpg | 2021-01-07 18:48 | 184K | |
![[IMG]](/icons/image2.gif) | Morgan grave.jpg | 2021-01-15 16:18 | 231K | |
![[IMG]](/icons/image2.gif) | Mr Webbs record_Metz.jpg | 2021-01-07 18:43 | 1.0M | |
![[IMG]](/icons/image2.gif) | Mulleur_Conspicuous Service Cross.jpg | 2021-01-05 13:01 | 355K | |
![[IMG]](/icons/image2.gif) | Neches.png | 2018-07-12 15:15 | 5.0M | |
![[IMG]](/icons/image2.gif) | Needles_2009_Anomaly.jpeg | 2023-01-30 15:22 | 643K | |
![[IMG]](/icons/image2.gif) | Needles_2009_DivePlanning.JPG | 2023-01-26 17:55 | 1.6M | |
![[IMG]](/icons/image2.gif) | Needles_2009_DiveSite.JPG | 2023-01-26 18:01 | 1.7M | |
![[IMG]](/icons/image2.gif) | Needles_2009_Side Scan of Cannon to North.png | 2023-01-30 15:06 | 281K | |
![[IMG]](/icons/image2.gif) | Needles_2010_Cyndrical concretion.JPG | 2023-01-30 15:56 | 177K | |
![[IMG]](/icons/image2.gif) | Needles_2010_Double fluked anchor.JPG | 2023-01-30 15:51 | 165K | |
![[IMG]](/icons/image2.gif) | Needles_2010_copper alloy cap.JPG | 2023-01-30 16:01 | 174K | |
![[IMG]](/icons/image2.gif) | Needles_2010_metal pipe_.JPG | 2023-01-30 15:35 | 317K | |
![[IMG]](/icons/image2.gif) | Needles_2012_gravelly rocky seabed.JPG | 2023-01-26 18:44 | 1.5M | |
![[IMG]](/icons/image2.gif) | Needles_2012_woodpiece_monitoring.JPG | 2023-01-26 18:25 | 4.0M | |
![[IMG]](/icons/image2.gif) | Needles_2013_Anomaly_Notch by scarf joint.png | 2023-01-26 18:28 | 2.1M | |
![[IMG]](/icons/image2.gif) | Needles_2013_Anomaly_view along timber.png | 2023-01-26 18:20 | 1.6M | |
![[IMG]](/icons/image2.gif) | Needles_2013_Anomaly plan.jpg | 2023-02-01 15:26 | 276K | |
![[IMG]](/icons/image2.gif) | Needles_2014_lead shot in gully.jpg | 2023-01-26 18:12 | 1.2M | |
![[IMG]](/icons/image2.gif) | Needles_Anchor_In_Situ.JPG | 2022-10-31 11:54 | 1.2M | |
![[IMG]](/icons/image2.gif) | Needles_Diver with Anchor.jpg | 2023-01-26 18:16 | 60K | |
![[IMG]](/icons/image2.gif) | Needles_PWA_Locations.png | 2023-02-01 15:19 | 250K | |
![[IMG]](/icons/image2.gif) | Needles_SitePlan.jpg | 2022-10-31 12:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | Needles_TaylorsMapHampshire-1759.jpg | 2023-01-23 11:58 | 615K | |
![[IMG]](/icons/image2.gif) | Netley 2.jpg | 2018-10-09 11:58 | 109K | |
![[IMG]](/icons/image2.gif) | Netley Peir.jpg | 2018-10-09 11:58 | 112K | |
![[IMG]](/icons/image2.gif) | Newbridge.png | 2018-07-12 15:18 | 366K | |
![[IMG]](/icons/image2.gif) | Newcastle Bathymetry 2016.png | 2018-09-06 15:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | Newspaper Article pg 2.JPG | 2020-12-16 09:58 | 103K | |
![[IMG]](/icons/image2.gif) | Nonnie Morgan Draft Card Pg 1.jpg | 2021-01-15 16:16 | 306K | |
![[IMG]](/icons/image2.gif) | Nonnie Morgan Draft Card Pg 2.jpg | 2021-01-15 16:17 | 260K | |
![[IMG]](/icons/image2.gif) | North Sea.png | 2018-07-12 15:21 | 431K | |
![[IMG]](/icons/image2.gif) | Northville.png | 2018-07-26 14:47 | 2.3M | |
![[IMG]](/icons/image2.gif) | Noya.png | 2018-07-12 15:24 | 1.8M | |
![[IMG]](/icons/image2.gif) | Nunima Bathymetry 2016.png | 2018-09-06 15:24 | 567K | |
![[IMG]](/icons/image2.gif) | Nyassa.png | 2018-07-12 15:27 | 1.4M | |
![[IMG]](/icons/image2.gif) | Oakby Bathymetry 2016.png | 2018-09-06 15:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | Obituary Hattisburg American 22 March 1988.jpg | 2020-12-15 16:41 | 31K | |
![[IMG]](/icons/image2.gif) | Obituary Photo.JPG | 2020-12-16 15:43 | 68K | |
![[IMG]](/icons/image2.gif) | Obituary photo.JPG | 2021-02-11 09:44 | 40K | |
![[IMG]](/icons/image2.gif) | Odom_Draft Card pg 1.jpg | 2021-01-05 13:02 | 246K | |
![[IMG]](/icons/image2.gif) | Odom_Draft Card pg 2.jpg | 2021-01-05 13:02 | 245K | |
![[IMG]](/icons/image2.gif) | Ole Lea Bathymetry 2015.png | 2018-10-04 15:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | PLM 4 Bathymetry 2014.png | 2018-10-04 15:40 | 1.1M | |
![[IMG]](/icons/image2.gif) | Pagenturm.png | 2018-11-19 13:48 | 239K | |
![[IMG]](/icons/image2.gif) | Pentyrch Bathymetry 2015.png | 2018-10-04 14:33 | 960K | |
![[IMG]](/icons/image2.gif) | Perm.png | 2018-07-12 15:29 | 447K | |
![[IMG]](/icons/image2.gif) | Peronne Bathymetry 2015.png | 2018-10-04 15:37 | 1.3M | |
![[IMG]](/icons/image2.gif) | Pg1 Hodges photo.jpg | 2020-12-16 09:52 | 242K | |
![[IMG]](/icons/image2.gif) | Photo Jewett 1980.JPG | 2020-12-14 18:07 | 32K | |
![[IMG]](/icons/image2.gif) | Photo Valley Times Star 29 Oct 1942.jpg | 2019-12-18 14:12 | 84K | |
![[IMG]](/icons/image2.gif) | Photo from FB_IMG_1594561700544 Maggie Fogg.jpg | 2021-01-07 18:05 | 32K | |
![[IMG]](/icons/image2.gif) | Photo from find a grave.jpg | 2021-03-16 12:11 | 17K | |
![[IMG]](/icons/image2.gif) | Photo in uniform.jpg | 2020-12-14 18:05 | 280K | |
![[IMG]](/icons/image2.gif) | Photo in uniform published in newsday (2).jpg | 2020-12-16 12:23 | 24K | |
![[IMG]](/icons/image2.gif) | Photo newsday dot com.jpg | 2020-12-16 12:24 | 41K | |
![[IMG]](/icons/image2.gif) | Pio A plane to left.JPG | 2021-01-18 11:20 | 349K | |
![[IMG]](/icons/image2.gif) | Pio Draft Card pg 1.jpg | 2021-03-11 15:42 | 226K | |
![[IMG]](/icons/image2.gif) | Pio Draft Card pg 2.jpg | 2021-03-11 15:42 | 188K | |
![[IMG]](/icons/image2.gif) | Pitho Bathymetry 2015.png | 2018-09-17 13:48 | 1.7M | |
![[IMG]](/icons/image2.gif) | Plumose Anenomes on Apley.jpg | 2024-09-05 10:13 | 2.2M | |
![[IMG]](/icons/image2.gif) | Polesley Bathymetry 2011.png | 2018-10-08 11:41 | 1.6M | |
![[IMG]](/icons/image2.gif) | Poljames.png | 2018-07-12 15:32 | 4.0M | |
![[IMG]](/icons/image2.gif) | Pomerianian Bathymetry 2015.png | 2018-10-04 15:43 | 1.9M | |
![[IMG]](/icons/image2.gif) | Pomone_AlumBa_2010_diver and Hause hole.jpg | 2023-02-01 16:38 | 540K | |
![[IMG]](/icons/image2.gif) | Pomone_Alum Bay 1_2014_Iron Knee.jpg | 2023-01-31 09:44 | 817K | |
![[IMG]](/icons/image2.gif) | Pomone_Alum Bay_2002_Outer Hull_courtest Michael Pitts.jpg | 2023-02-01 13:20 | 93K | |
![[IMG]](/icons/image2.gif) | Pomone_Alum Bay_2010_CarriageTruck wheel.jpg | 2023-01-31 08:57 | 1.3M | |
![[IMG]](/icons/image2.gif) | Pomone_AlumBay_2013_Courtesy Roland Brookes.jpg | 2023-02-01 16:47 | 846K | |
![[IMG]](/icons/image2.gif) | Pomone_AlumBay_2013_Ironwork-[Roland_Brooks].jpg | 2023-02-01 16:40 | 649K | |
![[IMG]](/icons/image2.gif) | Pomone_Needles c2000_diver in gully.jpg | 2023-01-26 18:32 | 124K | |
![[IMG]](/icons/image2.gif) | Ponus.jpg | 2018-10-09 12:05 | 175K | |
![[IMG]](/icons/image2.gif) | Propshaft tunnel - tony badham.jpg | 2018-10-29 12:41 | 118K | |
![[IMG]](/icons/image2.gif) | Pursuit Bathymetry 2016_small.png | 2018-09-17 14:49 | 221K | |
![[IMG]](/icons/image2.gif) | RD_Breech_Inscription_2019.jpg | 2019-05-29 18:48 | 608K | |
![[IMG]](/icons/image2.gif) | RD breech.jpg | 2019-07-24 14:21 | 650K | |
![[IMG]](/icons/image2.gif) | R_FINN_Inscription_2019.jpg | 2019-06-01 17:38 | 143K | |
![[IMG]](/icons/image2.gif) | R_Groth_Inscription_1975.jpg | 2019-05-29 18:44 | 286K | |
![[IMG]](/icons/image2.gif) | R_Groth_Inscription_1975.png | 2020-12-16 10:34 | 103K | |
![[IMG]](/icons/image2.gif) | Radaas Bathymetry 2015.png | 2018-10-04 15:45 | 1.6M | |
![[IMG]](/icons/image2.gif) | Ralph Groth_InServiceKit1944.jpg | 2019-05-24 14:15 | 1.1M | |
![[IMG]](/icons/image2.gif) | Ralph LeRoy Groth later years photo from find a grave by Ken Nagel.jpg | 2020-12-15 14:43 | 25K | |
![[IMG]](/icons/image2.gif) | Ralph Odel_Inscription_2019.JPG | 2019-05-29 18:46 | 399K | |
![[IMG]](/icons/image2.gif) | Ralph Odom.png | 2019-09-12 15:28 | 27K | |
![[IMG]](/icons/image2.gif) | Ralph Odom Mobile Alabama.JPG | 2020-12-16 12:35 | 359K | |
![[IMG]](/icons/image2.gif) | Ralph Odom updated.png | 2020-12-16 12:35 | 54K | |
![[IMG]](/icons/image2.gif) | Ralph_Groth_Draft Card pg 1_V2.jpg | 2021-01-05 12:34 | 152K | |
![[IMG]](/icons/image2.gif) | Ralph_Groth_Draft Card pg 2_V2.jpg | 2021-01-05 12:34 | 123K | |
![[IMG]](/icons/image2.gif) | Ralph_Odel_Inscription_2019.jpg | 2019-06-01 17:24 | 452K | |
![[IMG]](/icons/image2.gif) | Red Cross Map.jpg | 2021-01-15 17:20 | 66K | |
![[IMG]](/icons/image2.gif) | Regin Bathymetry 2014.png | 2018-09-18 13:13 | 602K | |
![[IMG]](/icons/image2.gif) | Reidar Bathymetry 2016.png | 2018-09-17 14:51 | 1.5M | |
![[IMG]](/icons/image2.gif) | Robert Breech from Daughter.JPG | 2021-01-05 14:14 | 33K | |
![[IMG]](/icons/image2.gif) | Robert Henry Smith Draft Card pg 1.jpg | 2020-12-16 17:54 | 244K | |
![[IMG]](/icons/image2.gif) | Robert Henry Smith Draft Card pg 2.jpg | 2020-12-16 17:56 | 224K | |
![[IMG]](/icons/image2.gif) | Robert_Golden_Inscription_2019.jpg | 2019-05-29 18:49 | 234K | |
![[IMG]](/icons/image2.gif) | Robert_Golden_inscription_2019.jpg | 2019-06-01 17:29 | 919K | |
![[IMG]](/icons/image2.gif) | Robert_M_Ray_inscription_2019.jpg | 2019-05-29 18:52 | 276K | |
![[IMG]](/icons/image2.gif) | Robert_Ray_Inscription_2019.jpg | 2019-06-01 17:23 | 556K | |
![[IMG]](/icons/image2.gif) | Rocky_Mount_Telegram_Fri__Jul_26__1991_.jpg | 2020-12-14 17:32 | 947K | |
![[IMG]](/icons/image2.gif) | Rosehill anchor.jpg | 2019-03-13 11:18 | 143K | |
![[IMG]](/icons/image2.gif) | Rosehill boiler 3.jpg | 2019-03-13 11:20 | 130K | |
![[IMG]](/icons/image2.gif) | Rosehill bpllards.jpg | 2019-03-13 11:21 | 150K | |
![[IMG]](/icons/image2.gif) | Rosehill engine 2.jpg | 2019-03-13 11:21 | 131K | |
![[IMG]](/icons/image2.gif) | Rosehill gun 3.jpg | 2019-03-13 11:22 | 140K | |
![[IMG]](/icons/image2.gif) | Rosehill mast.jpg | 2019-03-13 11:24 | 146K | |
![[IMG]](/icons/image2.gif) | Rosehill rudder survey - (c) Allen Murray.jpg | 2019-03-13 11:24 | 181K | |
![[IMG]](/icons/image2.gif) | Rosehill steering quadrant 2.jpg | 2019-03-13 11:23 | 149K | |
![[IMG]](/icons/image2.gif) | Rota.png | 2018-07-26 14:50 | 3.5M | |
![[IMG]](/icons/image2.gif) | Rydal Hall Bathymetry 2015.png | 2018-08-31 15:10 | 599K | |
![[IMG]](/icons/image2.gif) | SS GALWAY CASTLE.jpg | 2019-09-24 15:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | SSZ-15 300dpi.jpg | 2018-10-09 12:54 | 107K | |
![[ ]](/icons/layout.gif) | SV John Lockett Event and Voyages_Roger Burns.pdf | 2023-11-15 14:55 | 606K | |
![[IMG]](/icons/image2.gif) | Sabo Draft Card pg1.jpg | 2021-01-08 18:11 | 201K | |
![[IMG]](/icons/image2.gif) | Sabo Draft Card pg2.jpg | 2021-01-08 18:12 | 196K | |
![[IMG]](/icons/image2.gif) | Saidieh Bathymetry 2017.png | 2018-10-08 10:28 | 1.0M | |
![[IMG]](/icons/image2.gif) | SaintCecilia Bathymetry 2016.png | 2018-09-06 15:28 | 1.4M | |
![[IMG]](/icons/image2.gif) | Saint Chamond Bathymetry 2011.png | 2018-10-08 11:49 | 593K | |
![[IMG]](/icons/image2.gif) | Saint Emilion Bathymetry 2015.png | 2018-08-31 15:12 | 711K | |
![[IMG]](/icons/image2.gif) | Sam Sticht Brick.JPG | 2021-01-15 16:20 | 170K | |
![[IMG]](/icons/image2.gif) | Samuel McDonald Draft Card Side 1.jpg | 2021-01-07 18:34 | 278K | |
![[IMG]](/icons/image2.gif) | Samuel McDondal Draft Card Side 2.jpg | 2021-01-07 18:35 | 271K | |
![[IMG]](/icons/image2.gif) | Saxon Briton Bathymetry 2011.png | 2018-10-08 11:52 | 432K | |
![[IMG]](/icons/image2.gif) | SeaSerpent Bathymetry 2016.png | 2018-09-06 15:31 | 1.3M | |
![[IMG]](/icons/image2.gif) | Seabed Remains Sketch.JPG | 2024-09-05 10:13 | 33K | |
![[IMG]](/icons/image2.gif) | Seaplane Lighter H3 & Sopwith.jpg | 2018-10-09 12:07 | 167K | |
![[IMG]](/icons/image2.gif) | Selma Bathymetry 2014.png | 2018-09-18 13:14 | 2.0M | |
![[IMG]](/icons/image2.gif) | Service_Registration_Card_Harvey_1.JPG | 2020-12-15 14:22 | 222K | |
![[IMG]](/icons/image2.gif) | Service_Registration_Card_Harvey_2.JPG | 2020-12-15 14:16 | 84K | |
![[IMG]](/icons/image2.gif) | Service_Registration_R_D_Breech_1.JPG | 2020-12-15 14:57 | 180K | |
![[IMG]](/icons/image2.gif) | Service_Registration_R_D_Breech_2.JPG | 2020-12-15 15:02 | 83K | |
![[IMG]](/icons/image2.gif) | SevenSeas Bathymetry 2015.png | 2018-09-06 14:50 | 904K | |
![[IMG]](/icons/image2.gif) | Sevilla.png | 2018-07-26 14:53 | 464K | |
![[IMG]](/icons/image2.gif) | Shenandoah Bathymetry 2016.png | 2018-09-06 15:43 | 1.1M | |
![[IMG]](/icons/image2.gif) | Sindey Greenwald.jpg | 2019-12-18 14:22 | 118K | |
![[IMG]](/icons/image2.gif) | Sinking of Indian City.jpg | 2018-10-09 12:08 | 134K | |
![[IMG]](/icons/image2.gif) | Skaraas Bathymetry 2014.png | 2018-09-03 10:56 | 737K | |
![[IMG]](/icons/image2.gif) | Slater Draft Card pg 1.jpg | 2021-01-15 16:38 | 345K | |
![[IMG]](/icons/image2.gif) | Slater Draft Card pg 2.jpg | 2021-01-15 16:41 | 325K | |
![[IMG]](/icons/image2.gif) | Smith_Robert_wall_phot.jpg | 2020-12-16 18:14 | 3.2M | |
![[IMG]](/icons/image2.gif) | Snailly_by Matilda_Mason_08072020.jpg | 2021-02-02 17:59 | 327K | |
![[IMG]](/icons/image2.gif) | South Western 600dpi.jpg | 2018-10-09 12:09 | 174K | |
![[IMG]](/icons/image2.gif) | Spare prop. Just aft of engine - tony badham.jpg | 2018-10-29 12:41 | 94K | |
![[IMG]](/icons/image2.gif) | Sparkling Foam.jpg | 2018-10-09 12:20 | 139K | |
![[IMG]](/icons/image2.gif) | Sparkling Foam Bathymetry 2015.png | 2018-10-04 15:48 | 1.0M | |
![[IMG]](/icons/image2.gif) | Spital Bathymetry 2014.png | 2018-09-03 10:36 | 689K | |
![[IMG]](/icons/image2.gif) | St Andre.png | 2018-07-12 15:35 | 2.0M | |
![[IMG]](/icons/image2.gif) | Stanhope.png | 2018-07-12 15:38 | 372K | |
![[IMG]](/icons/image2.gif) | Start_1917_SSS_NavitusBay.jpg | 2018-10-10 10:23 | 888K | |
![[IMG]](/icons/image2.gif) | Stock Force Bathymetry 2014.png | 2018-10-04 14:42 | 1.2M | |
![[IMG]](/icons/image2.gif) | Survivors from Formidable.jpg | 2019-11-05 15:45 | 309K | |
![[IMG]](/icons/image2.gif) | TRThompson Bathymetry 2015.png | 2018-09-06 14:53 | 2.1M | |
![[IMG]](/icons/image2.gif) | The_Isle_of_Wight_by_G.E._Mitton_THE_NEEDLES.jpg | 2023-01-23 12:06 | 76K | |
![[IMG]](/icons/image2.gif) | Thorgny.png | 2018-07-12 15:40 | 352K | |
![[IMG]](/icons/image2.gif) | Thorsa Bathymetry 2011.png | 2018-10-08 13:47 | 1.2M | |
![[IMG]](/icons/image2.gif) | Trawlers Lena Melling & Weigelia Mine Sweepers.jpg | 2018-10-09 12:59 | 123K | |
![[IMG]](/icons/image2.gif) | Tregenna Bathymetry 2014.png | 2018-08-31 15:41 | 650K | |
![[IMG]](/icons/image2.gif) | U90.png | 2018-11-19 13:49 | 4.2M | |
![[IMG]](/icons/image2.gif) | U95.png | 2018-07-12 15:43 | 4.4M | |
![[IMG]](/icons/image2.gif) | UB-81.jpg | 2018-10-09 13:00 | 153K | |
![[IMG]](/icons/image2.gif) | UB-81.png | 2018-04-17 09:53 | 4.5M | |
![[IMG]](/icons/image2.gif) | UB21 Bathymetry 2013.png | 2018-10-04 15:57 | 371K | |
![[IMG]](/icons/image2.gif) | UB31 Bathymetry 2016.png | 2018-09-06 15:46 | 476K | |
![[IMG]](/icons/image2.gif) | UB55.png | 2018-07-26 15:42 | 1.2M | |
![[IMG]](/icons/image2.gif) | UB78 Bathymetry 2016.png | 2018-09-06 15:48 | 1.2M | |
![[IMG]](/icons/image2.gif) | UB81.png | 2018-11-19 13:53 | 3.2M | |
![[IMG]](/icons/image2.gif) | UB109.png | 2018-07-26 15:46 | 1.9M | |
![[IMG]](/icons/image2.gif) | UB130 Bathymetry 2015.png | 2018-09-06 14:56 | 764K | |
![[IMG]](/icons/image2.gif) | UC-51.png | 2018-07-12 15:46 | 386K | |
![[IMG]](/icons/image2.gif) | UC49.png | 2018-07-26 14:56 | 831K | |
![[IMG]](/icons/image2.gif) | UK Image SS Britania 08072014 ©Martin Davies 002.jpg | 2018-10-16 09:36 | 204K | |
![[IMG]](/icons/image2.gif) | UK Image SS Britania 08072014 ©Martin Davies 003.jpg | 2018-10-16 09:38 | 171K | |
![[IMG]](/icons/image2.gif) | UK Image SS Britania 08072014 ©Martin Davies 005.jpg | 2018-10-16 09:39 | 156K | |
![[IMG]](/icons/image2.gif) | UK Image SS Britania 08072014 ©Martin Davies 011.jpg | 2018-10-16 09:39 | 156K | |
![[IMG]](/icons/image2.gif) | UK Image SS Britania 08072014 ©Martin Davies 014.jpg | 2018-10-16 09:40 | 148K | |
![[IMG]](/icons/image2.gif) | UK Image SS Britania 08072014 ©Martin Davies 020.jpg | 2018-10-16 09:40 | 138K | |
![[IMG]](/icons/image2.gif) | USS Jacob Jones.jpg | 2018-10-09 13:01 | 162K | |
![[IMG]](/icons/image2.gif) | Ula.png | 2018-07-12 15:49 | 6.7M | |
![[IMG]](/icons/image2.gif) | Umba Bathymetry 2015.png | 2018-08-31 15:05 | 575K | |
![[IMG]](/icons/image2.gif) | Urban Grave 75th Commemoration.jpg | 2021-01-08 18:23 | 1.1M | |
![[IMG]](/icons/image2.gif) | Urban draft card pg 1.jpg | 2021-01-08 18:24 | 286K | |
![[IMG]](/icons/image2.gif) | Urban draft card pg 2.jpg | 2021-01-08 18:25 | 245K | |
![[IMG]](/icons/image2.gif) | Ursa Bathymetry 2015.png | 2018-10-04 15:50 | 1.3M | |
![[IMG]](/icons/image2.gif) | Uskmoor.png | 2018-07-12 15:53 | 429K | |
![[IMG]](/icons/image2.gif) | V44 & V82 600dpi.jpg | 2018-10-09 13:02 | 108K | |
![[IMG]](/icons/image2.gif) | V44 at Jutland.jpg | 2018-10-09 13:03 | 167K | |
![[IMG]](/icons/image2.gif) | VANCE DAVID PHOTO.jpeg | 2021-01-15 16:24 | 11K | |
![[IMG]](/icons/image2.gif) | VANCE GRAVE.jpg | 2021-01-15 16:26 | 115K | |
![[IMG]](/icons/image2.gif) | VANCE HER11131 WIDE REDUCE.jpg | 2021-01-15 16:25 | 636K | |
![[IMG]](/icons/image2.gif) | VANCE MISSING.jpg | 2021-01-15 16:27 | 101K | |
![[IMG]](/icons/image2.gif) | Val Salice Bathymetry 2009.png | 2018-10-08 12:14 | 1.8M | |
![[IMG]](/icons/image2.gif) | Valdes.png | 2018-04-26 16:01 | 494K | |
![[IMG]](/icons/image2.gif) | Vasco Bathymetry 2015.png | 2018-10-04 14:36 | 1.1M | |
![[IMG]](/icons/image2.gif) | Veghtstroom Bathymetry 2011.png | 2018-10-08 11:57 | 2.1M | |
![[IMG]](/icons/image2.gif) | Velox.png | 2018-11-19 13:50 | 1.0M | |
![[IMG]](/icons/image2.gif) | Venice High School Year Book Photo 1972 Math.jpg | 2020-12-16 15:42 | 6.8K | |
![[IMG]](/icons/image2.gif) | Veteran Compensation.jpg | 2020-12-15 17:14 | 1.0M | |
![[IMG]](/icons/image2.gif) | Veteran Compensation pg 2.jpg | 2020-12-15 17:14 | 772K | |
![[IMG]](/icons/image2.gif) | Victoria Bathymetry 2014.png | 2018-09-03 10:31 | 408K | |
![[IMG]](/icons/image2.gif) | Vigrid Bathymetry 2016_small.png | 2018-09-17 14:53 | 175K | |
![[IMG]](/icons/image2.gif) | Ville De Thann.png | 2018-07-12 15:56 | 1.4M | |
![[IMG]](/icons/image2.gif) | Vinovia.png | 2018-11-19 13:50 | 2.7M | |
![[IMG]](/icons/image2.gif) | W.E.Shirk.png | 2019-09-12 15:34 | 36K | |
![[IMG]](/icons/image2.gif) | W.E.Shirk_updated.png | 2020-12-16 12:54 | 67K | |
![[IMG]](/icons/image2.gif) | WHDwyer.png | 2018-07-26 15:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | W_Morris_Draft Card pg 1.jpg | 2021-01-05 13:00 | 523K | |
![[IMG]](/icons/image2.gif) | W_Morris_Draft Card pg 2.jpg | 2021-01-05 13:00 | 482K | |
![[IMG]](/icons/image2.gif) | Waikawa.png | 2018-07-26 14:59 | 901K | |
![[IMG]](/icons/image2.gif) | Walter Shirk 206 Mini Reunion Dec 1st 2000.jpg | 2020-12-16 12:46 | 471K | |
![[IMG]](/icons/image2.gif) | Walter Shirk Draft Card Side 1.jpg | 2020-12-16 12:48 | 401K | |
![[IMG]](/icons/image2.gif) | Walter Shirk Draft Card Side 2.jpg | 2020-12-16 12:49 | 414K | |
![[IMG]](/icons/image2.gif) | Walter Shirk Yearbook_profile_photo 1942.jpg | 2019-12-18 15:03 | 6.4K | |
![[IMG]](/icons/image2.gif) | Walter_Wells_1945.jpg | 2019-05-29 13:07 | 558K | |
![[IMG]](/icons/image2.gif) | Walter_Wells_Draft_1.JPG | 2021-01-08 18:35 | 211K | |
![[IMG]](/icons/image2.gif) | Walter_Wells_Draft_2.JPG | 2021-01-08 18:35 | 84K | |
![[IMG]](/icons/image2.gif) | Walter_Wells_Inscription_1973.jpg | 2019-05-29 18:55 | 736K | |
![[IMG]](/icons/image2.gif) | Wapello.png | 2018-11-19 13:50 | 3.9M | |
![[IMG]](/icons/image2.gif) | War Knight.png | 2018-10-10 10:10 | 416K | |
![[IMG]](/icons/image2.gif) | War Knight 1200dpi.jpg | 2018-10-09 13:04 | 130K | |
![[IMG]](/icons/image2.gif) | War Tune Bathymetry 2014.png | 2018-09-03 10:54 | 479K | |
![[IMG]](/icons/image2.gif) | Warilda Bathymetry 2014.png | 2018-10-04 14:46 | 789K | |
![[IMG]](/icons/image2.gif) | Warsaw.png | 2018-07-26 15:02 | 1.4M | |
![[IMG]](/icons/image2.gif) | Wayne Harvey_Inscription_1975.jpg | 2019-05-29 18:57 | 380K | |
![[IMG]](/icons/image2.gif) | Wayne Harvey_Inscription_1975.png | 2021-01-07 10:19 | 96K | |
![[IMG]](/icons/image2.gif) | Wayne Harvey_Uniform_Photo.jpg | 2019-05-29 15:48 | 486K | |
![[IMG]](/icons/image2.gif) | Wayne Harvey_Uniform_Photo_edited.jpg | 2019-12-18 14:29 | 599K | |
![[IMG]](/icons/image2.gif) | Wayne and May Harvey January 1973.JPG | 2020-12-15 14:14 | 18K | |
![[IMG]](/icons/image2.gif) | Webbs list of names and addresses_Sabo.jpg | 2021-01-08 18:13 | 1.0M | |
![[IMG]](/icons/image2.gif) | Webbs recording_Moore.jpg | 2021-01-07 18:49 | 1.0M | |
![[IMG]](/icons/image2.gif) | Wells_Newspaper_1973.jpg | 2019-06-01 17:32 | 408K | |
![[IMG]](/icons/image2.gif) | Wempen Baltimore 1945.jpg | 2020-12-16 15:44 | 201K | |
![[IMG]](/icons/image2.gif) | Wempen_Draft Card pg 1.jpg | 2021-01-05 13:04 | 329K | |
![[IMG]](/icons/image2.gif) | Wempen_Draft Card pg 2.jpg | 2021-01-05 13:04 | 298K | |
![[IMG]](/icons/image2.gif) | Wempen separated bricks.JPG | 2021-02-09 11:02 | 132K | |
![[IMG]](/icons/image2.gif) | West Draft Card pg 1.jpg | 2021-03-11 15:43 | 219K | |
![[IMG]](/icons/image2.gif) | West Draft Card pg 2.jpg | 2021-03-11 15:43 | 189K | |
![[IMG]](/icons/image2.gif) | Western Coast.png | 2018-11-19 13:50 | 3.2M | |
![[IMG]](/icons/image2.gif) | Western Coast Bathymetry 2014.png | 2018-09-03 10:33 | 488K | |
![[IMG]](/icons/image2.gif) | WillAndMaggie.png | 2018-07-26 15:49 | 1.9M | |
![[IMG]](/icons/image2.gif) | William Roby Grave.jpg | 2021-01-08 18:09 | 326K | |
![[IMG]](/icons/image2.gif) | William and Grace Photo from Ancestry with permission.jpg | 2021-01-08 18:01 | 31K | |
![[IMG]](/icons/image2.gif) | William and mother before leaving Italt 1922 Ancestry.jpg | 2021-01-08 18:02 | 34K | |
![[IMG]](/icons/image2.gif) | Wilson C Hall Draft Card Side 1.jpg | 2021-01-07 10:06 | 186K | |
![[IMG]](/icons/image2.gif) | Wilson C Hall Draft Card Side 2.jpg | 2021-01-07 10:07 | 179K | |
![[IMG]](/icons/image2.gif) | Wilson Charles Hall Grave.jpg | 2021-01-07 10:11 | 17K | |
![[IMG]](/icons/image2.gif) | Wilson Hall_inscription.png | 2021-01-07 10:09 | 23K | |
![[IMG]](/icons/image2.gif) | Wilson Hall_inscription_W.png | 2021-01-07 10:10 | 29K | |
![[IMG]](/icons/image2.gif) | Wilson_B22_Inscription_2019.JPG | 2019-05-29 18:59 | 372K | |
![[IMG]](/icons/image2.gif) | Wilson_Inscription_2019.jpg | 2019-06-01 17:21 | 497K | |
![[IMG]](/icons/image2.gif) | W knight.png | 2019-09-12 15:32 | 48K | |
![[IMG]](/icons/image2.gif) | W knight_inscrip.png | 2020-12-22 09:32 | 39K | |
![[IMG]](/icons/image2.gif) | Wm Mueller.jpg | 2019-09-12 15:37 | 177K | |
![[IMG]](/icons/image2.gif) | Wm Mueller New York_Inscription_2019.JPG | 2019-05-29 19:01 | 254K | |
![[IMG]](/icons/image2.gif) | Wm_Mueller_Inscription_2019.jpg | 2019-06-01 17:26 | 486K | |
![[IMG]](/icons/image2.gif) | Woodrow Morris findagrave.jpg | 2020-12-16 11:50 | 127K | |
![[IMG]](/icons/image2.gif) | Yearbook 1942.JPG | 2020-12-16 12:45 | 118K | |
![[IMG]](/icons/image2.gif) | Zone Bathymetry 2011.png | 2018-10-08 13:48 | 2.1M | |
![[IMG]](/icons/image2.gif) | _B7K8103.jpg | 2021-02-02 18:00 | 10M | |
![[IMG]](/icons/image2.gif) | _Death at Sea 15 April 1918_William McGregor.jpg | 2023-11-20 13:41 | 479K | |
![[IMG]](/icons/image2.gif) | anglo_sax__sketchfab_thumb.png | 2023-09-18 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | azemmour2010_001.jpg | 2018-04-03 17:17 | 262K | |
![[IMG]](/icons/image2.gif) | azemmour2010_002.jpg | 2018-04-03 17:17 | 154K | |
![[IMG]](/icons/image2.gif) | azemmour2010_003.jpg | 2018-04-03 17:18 | 202K | |
![[IMG]](/icons/image2.gif) | azemmour2011_001.JPG | 2018-04-03 17:17 | 3.0M | |
![[IMG]](/icons/image2.gif) | azemmour2011_002.JPG | 2018-04-03 17:16 | 2.9M | |
![[IMG]](/icons/image2.gif) | bronze-star_Colby.jpg | 2021-01-05 13:46 | 36K | |
![[IMG]](/icons/image2.gif) | bronze-star_dooling.jpg | 2021-01-05 14:01 | 36K | |
![[IMG]](/icons/image2.gif) | bronze-star_urban.jpg | 2021-01-08 18:23 | 36K | |
![[IMG]](/icons/image2.gif) | campen1_sketchfab_thumb.png | 2023-09-18 11:02 | 2.1M | |
![[IMG]](/icons/image2.gif) | campen2_sketchfab_thumb.png | 2023-09-18 11:53 | 2.0M | |
![[IMG]](/icons/image2.gif) | cropped photo.JPG | 2019-12-18 14:07 | 30K | |
![[IMG]](/icons/image2.gif) | curthodges_wb.png | 2020-12-16 10:22 | 58K | |
![[IMG]](/icons/image2.gif) | dooling.jpg | 2019-07-24 12:46 | 80K | |
![[IMG]](/icons/image2.gif) | dooling inscription.jpg | 2021-01-05 13:59 | 80K | |
![[IMG]](/icons/image2.gif) | eddie meyer.jpg | 2019-07-24 13:16 | 752K | |
![[IMG]](/icons/image2.gif) | edited brick with red cross visible.JPG | 2020-12-14 16:20 | 398K | |
![[IMG]](/icons/image2.gif) | geophys serrana_MAT.jpg | 2023-09-06 19:14 | 676K | |
![[IMG]](/icons/image2.gif) | greenway.jpg | 2019-07-24 14:11 | 1.0M | |
![[IMG]](/icons/image2.gif) | images.jfif | 2021-02-02 17:58 | 5.5K | |
![[IMG]](/icons/image2.gif) | jewett a callaway.jpg | 2019-07-24 14:22 | 748K | |
![[IMG]](/icons/image2.gif) | jewett a callaway.png | 2020-12-16 10:14 | 199K | |
![[IMG]](/icons/image2.gif) | laurence mathis.jpg | 2019-07-24 14:20 | 944K | |
![[IMG]](/icons/image2.gif) | pearl Bathymetry 2014.png | 2018-09-03 11:03 | 449K | |
![[IMG]](/icons/image2.gif) | photo.jpg | 2019-12-18 15:29 | 20K | |
![[IMG]](/icons/image2.gif) | photo from Charleston High School yearbook 1939.jpg | 2021-01-15 16:40 | 41K | |
![[IMG]](/icons/image2.gif) | pomone1_sketchfab_thumb.png | 2023-09-18 11:06 | 2.0M | |
![[IMG]](/icons/image2.gif) | pomone_need1_sketchfab_thumb.png | 2023-09-18 11:07 | 2.3M | |
![[IMG]](/icons/image2.gif) | pomone_need2_sketchfab_thumb.png | 2023-09-18 11:07 | 2.1M | |
![[IMG]](/icons/image2.gif) | pomone_need3_sketchfab_thumb.png | 2023-09-18 11:07 | 2.1M | |
![[IMG]](/icons/image2.gif) | poss 2 dc pg 1.jpg | 2021-03-11 15:10 | 281K | |
![[IMG]](/icons/image2.gif) | post card1.jpg | 2019-11-06 14:42 | 350K | |
![[IMG]](/icons/image2.gif) | post card hms Agamemnon.jpg | 2019-11-06 14:37 | 76K | |
![[IMG]](/icons/image2.gif) | rhinebridgeby88th.jpg | 2020-12-29 09:34 | 107K | |
![[IMG]](/icons/image2.gif) | robert golden.jpg | 2019-07-24 14:21 | 671K | |
![[IMG]](/icons/image2.gif) | robert smith.png | 2019-09-12 15:31 | 23K | |
![[IMG]](/icons/image2.gif) | robert smith_inscrip.jpg | 2020-12-22 10:05 | 32K | |
![[IMG]](/icons/image2.gif) | spare prop Redesmere.jpg | 2018-10-16 09:31 | 85K | |
![[DIR]](/icons/folder.gif) | thumbs/ | 2024-09-05 10:13 | - | |
![[IMG]](/icons/image2.gif) | uncle dee - Copy from Niece Judy with permission to use Delbert, Ethel and Nina.jpg | 2019-12-18 15:07 | 159K | |
|